C31H64Cl2MnN5+4 — CID 161075645
4-[4-(6,7-dichloro-11-methyl-1,4,8,11-tetrazabicyclo[6.6.2]hexadecan-7-yl)butyl]undecyl-trimethylazanium;manganese(3+) (PubChem CID 161075645) has the molecular formula C31H64Cl2MnN5+4 and a molecular weight of 632.73 g/mol. Its IUPAC name is 4-[4-(6,7-dichloro-11-methyl-1,4,8,11-tetrazabicyclo[6.6.2]hexadecan-7-yl)butyl]undecyl-trimethylazanium;manganese(3+).
| Compound Name | 4-[4-(6,7-dichloro-11-methyl-1,4,8,11-tetrazabicyclo[6.6.2]hexadecan-7-yl)butyl]undecyl-trimethylazanium;manganese(3+) |
|---|---|
| PubChem CID | 161075645 |
| Molecular Formula | C31H64Cl2MnN5+4 |
| Molecular Weight | 632.73 g/mol |
| Exact Mass | 631.39 |
| IUPAC Name | 4-[4-(6,7-dichloro-11-methyl-1,4,8,11-tetrazabicyclo[6.6.2]hexadecan-7-yl)butyl]undecyl-trimethylazanium;manganese(3+) |
| SMILES | CCCCCCCC(CCCCC1(Cl)C(Cl)CNCCN2CCCN(C)CCN1CC2)CCC[N+](C)(C)C.[Mn+3] |
| InChI | InChI=1S/C31H64Cl2N5.Mn/c1-6-7-8-9-10-15-29(17-13-27-38(3,4)5)16-11-12-18-31(33)30(32)28-34-19-22-36-21-14-20-35(2)23-25-37(31)26-24-36;/h29-30,34H,6-28H2,1-5H3;/q+1;+3 |
| InChIKey | UFFSONSLBCGGEZ-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 21.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.73 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|