About methane;N-[(5S)-5-(methylamino)-6-oxoheptyl]ethanesulfonamide
methane;N-[(5S)-5-(methylamino)-6-oxoheptyl]ethanesulfonamide (PubChem CID 161075660) has the molecular formula C12H30N2O3S
and a molecular weight of 282.45 g/mol. Its IUPAC name is methane;N-[(5S)-5-(methylamino)-6-oxoheptyl]ethanesulfonamide.
Molecular Properties
| Compound Name | methane;N-[(5S)-5-(methylamino)-6-oxoheptyl]ethanesulfonamide |
| PubChem CID | 161075660 |
| Molecular Formula | C12H30N2O3S |
| Molecular Weight | 282.45 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | methane;N-[(5S)-5-(methylamino)-6-oxoheptyl]ethanesulfonamide |
| SMILES | C.C.CCS(=O)(=O)NCCCC[C@H](NC)C(C)=O |
| InChI | InChI=1S/C10H22N2O3S.2CH4/c1-4-16(14,15)12-8-6-5-7-10(11-3)9(2)13;;/h10-12H,4-8H2,1-3H3;2*1H4/t10-;;/m0../s1 |
| InChIKey | UFFTZPRNGXJYOA-XRIOVQLTSA-N |
| XLogP | 1.55 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.45 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methane;N-[(5S)-5-(methylamino)-6-oxoheptyl]ethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;N-[(5S)-5-(methylamino)-6-oxoheptyl]ethanesulfonamide?
The IUPAC name of methane;N-[(5S)-5-(methylamino)-6-oxoheptyl]ethanesulfonamide (CID 161075660) is methane;N-[(5S)-5-(methylamino)-6-oxoheptyl]ethanesulfonamide.
What is the SMILES notation for methane;N-[(5S)-5-(methylamino)-6-oxoheptyl]ethanesulfonamide?
The canonical SMILES for methane;N-[(5S)-5-(methylamino)-6-oxoheptyl]ethanesulfonamide is C.C.CCS(=O)(=O)NCCCC[C@H](NC)C(C)=O.
What is the InChIKey of methane;N-[(5S)-5-(methylamino)-6-oxoheptyl]ethanesulfonamide?
The InChIKey is UFFTZPRNGXJYOA-XRIOVQLTSA-N. The full InChI is InChI=1S/C10H22N2O3S.2CH4/c1-4-16(14,15)12-8-6-5-7-10(11-3)9(2)13;;/h10-12H,4-8H2,1-3H3;2*1H4/t10-;;/m0../s1.
What are the key properties of methane;N-[(5S)-5-(methylamino)-6-oxoheptyl]ethanesulfonamide?
methane;N-[(5S)-5-(methylamino)-6-oxoheptyl]ethanesulfonamide has a molecular weight of 282.45 g/mol, XLogP of 1.55, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methane;N-[(5S)-5-(methylamino)-6-oxoheptyl]ethanesulfonamide is sourced from PubChem (CID 161075660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).