About methylimino(oxo)methane;naphthalene
methylimino(oxo)methane;naphthalene (PubChem CID 161076109) has the molecular formula C14H14N2O2
and a molecular weight of 242.28 g/mol. Its IUPAC name is methylimino(oxo)methane;naphthalene.
Molecular Properties
| Compound Name | methylimino(oxo)methane;naphthalene |
| PubChem CID | 161076109 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | methylimino(oxo)methane;naphthalene |
| SMILES | CN=C=O.CN=C=O.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.2C2H3NO/c1-2-6-10-8-4-3-7-9(10)5-1;2*1-3-2-4/h1-8H;2*1H3 |
| InChIKey | UFHJOALOSZSHCV-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze methylimino(oxo)methane;naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylimino(oxo)methane;naphthalene?
The IUPAC name of methylimino(oxo)methane;naphthalene (CID 161076109) is methylimino(oxo)methane;naphthalene.
What is the SMILES notation for methylimino(oxo)methane;naphthalene?
The canonical SMILES for methylimino(oxo)methane;naphthalene is CN=C=O.CN=C=O.c1ccc2ccccc2c1.
What is the InChIKey of methylimino(oxo)methane;naphthalene?
The InChIKey is UFHJOALOSZSHCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.2C2H3NO/c1-2-6-10-8-4-3-7-9(10)5-1;2*1-3-2-4/h1-8H;2*1H3.
What are the key properties of methylimino(oxo)methane;naphthalene?
methylimino(oxo)methane;naphthalene has a molecular weight of 242.28 g/mol, XLogP of 2.74, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methylimino(oxo)methane;naphthalene is sourced from PubChem (CID 161076109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).