C56H33N5 — CID 161076684
2-[3,6-bis(9-phenylcarbazol-3-yl)carbazol-9-yl]-4-isocyanobenzonitrile (PubChem CID 161076684) has the molecular formula C56H33N5 and a molecular weight of 775.92 g/mol. Its IUPAC name is 2-[3,6-bis(9-phenylcarbazol-3-yl)carbazol-9-yl]-4-isocyanobenzonitrile.
| Compound Name | 2-[3,6-bis(9-phenylcarbazol-3-yl)carbazol-9-yl]-4-isocyanobenzonitrile |
|---|---|
| PubChem CID | 161076684 |
| Molecular Formula | C56H33N5 |
| Molecular Weight | 775.92 g/mol |
| Exact Mass | 775.27 |
| IUPAC Name | 2-[3,6-bis(9-phenylcarbazol-3-yl)carbazol-9-yl]-4-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1ccc(C#N)c(-n2c3ccc(-c4ccc5c(c4)c4ccccc4n5-c4ccccc4)cc3c3cc(-c4ccc5c(c4)c4ccccc4n5-c4ccccc4)ccc32)c1 |
| InChI | InChI=1S/C56H33N5/c1-58-41-25-20-40(35-57)56(34-41)61-54-28-23-38(36-21-26-52-46(30-36)44-16-8-10-18-50(44)59(52)42-12-4-2-5-13-42)32-48(54)49-33-39(24-29-55(49)61)37-22-27-53-47(31-37)45-17-9-11-19-51(45)60(53)43-14-6-3-7-15-43/h2-34H |
| InChIKey | OCLMECGIMXBWER-UHFFFAOYSA-N |
| XLogP | 14.73 |
| TPSA | 42.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.92 |
| LogP ≤ 5 | 14.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|