C25H32F3N5O — CID 161079174
2-butoxy-6-methylidene-8-[[3-(pyrrolidin-1-ylmethyl)-5-(trifluoromethyl)phenyl]methyl]-5,7-dihydropyrido[2,3-d]pyrimidin-4-amine (PubChem CID 161079174) has the molecular formula C25H32F3N5O and a molecular weight of 475.56 g/mol. Its IUPAC name is 2-butoxy-6-methylidene-8-[[3-(pyrrolidin-1-ylmethyl)-5-(trifluoromethyl)phenyl]methyl]-5,7-dihydropyrido[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-butoxy-6-methylidene-8-[[3-(pyrrolidin-1-ylmethyl)-5-(trifluoromethyl)phenyl]methyl]-5,7-dihydropyrido[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 161079174 |
| Molecular Formula | C25H32F3N5O |
| Molecular Weight | 475.56 g/mol |
| Exact Mass | 475.26 |
| IUPAC Name | 2-butoxy-6-methylidene-8-[[3-(pyrrolidin-1-ylmethyl)-5-(trifluoromethyl)phenyl]methyl]-5,7-dihydropyrido[2,3-d]pyrimidin-4-amine |
| SMILES | C=C1Cc2c(N)nc(OCCCC)nc2N(Cc2cc(CN3CCCC3)cc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C25H32F3N5O/c1-3-4-9-34-24-30-22(29)21-10-17(2)14-33(23(21)31-24)16-19-11-18(15-32-7-5-6-8-32)12-20(13-19)25(26,27)28/h11-13H,2-10,14-16H2,1H3,(H2,29,30,31) |
| InChIKey | UERHPZZSESCYFN-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.56 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|