About 3-chlorobenzenecarboperoxoic acid;1-(2-methylsulfonylpyrimidin-4-yl)indazole
3-chlorobenzenecarboperoxoic acid;1-(2-methylsulfonylpyrimidin-4-yl)indazole (PubChem CID 161079341) has the molecular formula C19H15ClN4O5S
and a molecular weight of 446.87 g/mol. Its IUPAC name is 3-chlorobenzenecarboperoxoic acid;1-(2-methylsulfonylpyrimidin-4-yl)indazole.
Molecular Properties
| Compound Name | 3-chlorobenzenecarboperoxoic acid;1-(2-methylsulfonylpyrimidin-4-yl)indazole |
| PubChem CID | 161079341 |
| Molecular Formula | C19H15ClN4O5S |
| Molecular Weight | 446.87 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | 3-chlorobenzenecarboperoxoic acid;1-(2-methylsulfonylpyrimidin-4-yl)indazole |
| SMILES | CS(=O)(=O)c1nccc(-n2ncc3ccccc32)n1.O=C(OO)c1cccc(Cl)c1 |
| InChI | InChI=1S/C12H10N4O2S.C7H5ClO3/c1-19(17,18)12-13-7-6-11(15-12)16-10-5-3-2-4-9(10)8-14-16;8-6-3-1-2-5(4-6)7(9)11-10/h2-8H,1H3;1-4,10H |
| InChIKey | UFRWAPUXWDRQAR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 124.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.87 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 3-chlorobenzenecarboperoxoic acid;1-(2-methylsulfonylpyrimidin-4-yl)indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chlorobenzenecarboperoxoic acid;1-(2-methylsulfonylpyrimidin-4-yl)indazole?
The IUPAC name of 3-chlorobenzenecarboperoxoic acid;1-(2-methylsulfonylpyrimidin-4-yl)indazole (CID 161079341) is 3-chlorobenzenecarboperoxoic acid;1-(2-methylsulfonylpyrimidin-4-yl)indazole.
What is the SMILES notation for 3-chlorobenzenecarboperoxoic acid;1-(2-methylsulfonylpyrimidin-4-yl)indazole?
The canonical SMILES for 3-chlorobenzenecarboperoxoic acid;1-(2-methylsulfonylpyrimidin-4-yl)indazole is CS(=O)(=O)c1nccc(-n2ncc3ccccc32)n1.O=C(OO)c1cccc(Cl)c1.
What is the InChIKey of 3-chlorobenzenecarboperoxoic acid;1-(2-methylsulfonylpyrimidin-4-yl)indazole?
The InChIKey is UFRWAPUXWDRQAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N4O2S.C7H5ClO3/c1-19(17,18)12-13-7-6-11(15-12)16-10-5-3-2-4-9(10)8-14-16;8-6-3-1-2-5(4-6)7(9)11-10/h2-8H,1H3;1-4,10H.
What are the key properties of 3-chlorobenzenecarboperoxoic acid;1-(2-methylsulfonylpyrimidin-4-yl)indazole?
3-chlorobenzenecarboperoxoic acid;1-(2-methylsulfonylpyrimidin-4-yl)indazole has a molecular weight of 446.87 g/mol, XLogP of 3.19, 3 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chlorobenzenecarboperoxoic acid;1-(2-methylsulfonylpyrimidin-4-yl)indazole is sourced from PubChem (CID 161079341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).