About 3-azido-7-hydroxychromen-2-one;3-hydroxychromen-2-one;azide
3-azido-7-hydroxychromen-2-one;3-hydroxychromen-2-one;azide (PubChem CID 161084237) has the molecular formula C18H11N6O6-
and a molecular weight of 407.32 g/mol. Its IUPAC name is 3-azido-7-hydroxychromen-2-one;3-hydroxychromen-2-one;azide.
Molecular Properties
| Compound Name | 3-azido-7-hydroxychromen-2-one;3-hydroxychromen-2-one;azide |
| PubChem CID | 161084237 |
| Molecular Formula | C18H11N6O6- |
| Molecular Weight | 407.32 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | 3-azido-7-hydroxychromen-2-one;3-hydroxychromen-2-one;azide |
| SMILES | O=c1oc2ccccc2cc1O.[N-]=[N+]=Nc1cc2ccc(O)cc2oc1=O.[N-]=[N+]=[N-] |
| InChI | InChI=1S/C9H5N3O3.C9H6O3.N3/c10-12-11-7-3-5-1-2-6(13)4-8(5)15-9(7)14;10-7-5-6-3-1-2-4-8(6)12-9(7)11;1-3-2/h1-4,13H;1-5,10H;/q;;-1 |
| InChIKey | UGHJWGVLHKHOJJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 208.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.32 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 3-azido-7-hydroxychromen-2-one;3-hydroxychromen-2-one;azide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-azido-7-hydroxychromen-2-one;3-hydroxychromen-2-one;azide?
The IUPAC name of 3-azido-7-hydroxychromen-2-one;3-hydroxychromen-2-one;azide (CID 161084237) is 3-azido-7-hydroxychromen-2-one;3-hydroxychromen-2-one;azide.
What is the SMILES notation for 3-azido-7-hydroxychromen-2-one;3-hydroxychromen-2-one;azide?
The canonical SMILES for 3-azido-7-hydroxychromen-2-one;3-hydroxychromen-2-one;azide is O=c1oc2ccccc2cc1O.[N-]=[N+]=Nc1cc2ccc(O)cc2oc1=O.[N-]=[N+]=[N-].
What is the InChIKey of 3-azido-7-hydroxychromen-2-one;3-hydroxychromen-2-one;azide?
The InChIKey is UGHJWGVLHKHOJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5N3O3.C9H6O3.N3/c10-12-11-7-3-5-1-2-6(13)4-8(5)15-9(7)14;10-7-5-6-3-1-2-4-8(6)12-9(7)11;1-3-2/h1-4,13H;1-5,10H;/q;;-1.
What are the key properties of 3-azido-7-hydroxychromen-2-one;3-hydroxychromen-2-one;azide?
3-azido-7-hydroxychromen-2-one;3-hydroxychromen-2-one;azide has a molecular weight of 407.32 g/mol, XLogP of 4.81, 1 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-azido-7-hydroxychromen-2-one;3-hydroxychromen-2-one;azide is sourced from PubChem (CID 161084237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).