C21H24F3N7O2S — CID 161084705
N-propyl-5-[4-[4-[[3-(trifluoromethyl)phenyl]methylcarbamoyl]triazol-1-yl]butyl]-1,3,4-thiadiazole-2-carboxamide (PubChem CID 161084705) has the molecular formula C21H24F3N7O2S and a molecular weight of 495.53 g/mol. Its IUPAC name is N-propyl-5-[4-[4-[[3-(trifluoromethyl)phenyl]methylcarbamoyl]triazol-1-yl]butyl]-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | N-propyl-5-[4-[4-[[3-(trifluoromethyl)phenyl]methylcarbamoyl]triazol-1-yl]butyl]-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 161084705 |
| Molecular Formula | C21H24F3N7O2S |
| Molecular Weight | 495.53 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | N-propyl-5-[4-[4-[[3-(trifluoromethyl)phenyl]methylcarbamoyl]triazol-1-yl]butyl]-1,3,4-thiadiazole-2-carboxamide |
| SMILES | CCCNC(=O)c1nnc(CCCCn2cc(C(=O)NCc3cccc(C(F)(F)F)c3)nn2)s1 |
| InChI | InChI=1S/C21H24F3N7O2S/c1-2-9-25-19(33)20-29-28-17(34-20)8-3-4-10-31-13-16(27-30-31)18(32)26-12-14-6-5-7-15(11-14)21(22,23)24/h5-7,11,13H,2-4,8-10,12H2,1H3,(H,25,33)(H,26,32) |
| InChIKey | SVHXARQDHVJBCV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 114.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.53 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|