About 1-[[2,5-dimethyl-4-[(2-methylphenyl)diazenyl]phenyl]methylimino]naphthalen-2-one
1-[[2,5-dimethyl-4-[(2-methylphenyl)diazenyl]phenyl]methylimino]naphthalen-2-one (PubChem CID 161085798) has the molecular formula C26H23N3O
and a molecular weight of 393.49 g/mol. Its IUPAC name is 1-[[2,5-dimethyl-4-[(2-methylphenyl)diazenyl]phenyl]methylimino]naphthalen-2-one.
Molecular Properties
| Compound Name | 1-[[2,5-dimethyl-4-[(2-methylphenyl)diazenyl]phenyl]methylimino]naphthalen-2-one |
| PubChem CID | 161085798 |
| Molecular Formula | C26H23N3O |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 1-[[2,5-dimethyl-4-[(2-methylphenyl)diazenyl]phenyl]methylimino]naphthalen-2-one |
| SMILES | Cc1cc(/N=N/c2ccccc2C)c(C)cc1C/N=C1\C(=O)C=Cc2ccccc21 |
| InChI | InChI=1S/C26H23N3O/c1-17-8-4-7-11-23(17)28-29-24-15-18(2)21(14-19(24)3)16-27-26-22-10-6-5-9-20(22)12-13-25(26)30/h4-15H,16H2,1-3H3/b27-26-,29-28+ |
| InChIKey | UGMKMGDQUAEZIO-KVZOUHTRSA-N |
| XLogP | 6.61 |
| TPSA | 54.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[[2,5-dimethyl-4-[(2-methylphenyl)diazenyl]phenyl]methylimino]naphthalen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2,5-dimethyl-4-[(2-methylphenyl)diazenyl]phenyl]methylimino]naphthalen-2-one?
The IUPAC name of 1-[[2,5-dimethyl-4-[(2-methylphenyl)diazenyl]phenyl]methylimino]naphthalen-2-one (CID 161085798) is 1-[[2,5-dimethyl-4-[(2-methylphenyl)diazenyl]phenyl]methylimino]naphthalen-2-one.
What is the SMILES notation for 1-[[2,5-dimethyl-4-[(2-methylphenyl)diazenyl]phenyl]methylimino]naphthalen-2-one?
The canonical SMILES for 1-[[2,5-dimethyl-4-[(2-methylphenyl)diazenyl]phenyl]methylimino]naphthalen-2-one is Cc1cc(/N=N/c2ccccc2C)c(C)cc1C/N=C1\C(=O)C=Cc2ccccc21.
What is the InChIKey of 1-[[2,5-dimethyl-4-[(2-methylphenyl)diazenyl]phenyl]methylimino]naphthalen-2-one?
The InChIKey is UGMKMGDQUAEZIO-KVZOUHTRSA-N. The full InChI is InChI=1S/C26H23N3O/c1-17-8-4-7-11-23(17)28-29-24-15-18(2)21(14-19(24)3)16-27-26-22-10-6-5-9-20(22)12-13-25(26)30/h4-15H,16H2,1-3H3/b27-26-,29-28+.
What are the key properties of 1-[[2,5-dimethyl-4-[(2-methylphenyl)diazenyl]phenyl]methylimino]naphthalen-2-one?
1-[[2,5-dimethyl-4-[(2-methylphenyl)diazenyl]phenyl]methylimino]naphthalen-2-one has a molecular weight of 393.49 g/mol, XLogP of 6.61, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2,5-dimethyl-4-[(2-methylphenyl)diazenyl]phenyl]methylimino]naphthalen-2-one is sourced from PubChem (CID 161085798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).