About (3-ethylbenzene-5-id-1-yl)methanol;tungsten;yttrium
(3-ethylbenzene-5-id-1-yl)methanol;tungsten;yttrium (PubChem CID 161087005) has the molecular formula C9H11OW2Y-
and a molecular weight of 591.77 g/mol. Its IUPAC name is (3-ethylbenzene-5-id-1-yl)methanol;tungsten;yttrium.
Molecular Properties
| Compound Name | (3-ethylbenzene-5-id-1-yl)methanol;tungsten;yttrium |
| PubChem CID | 161087005 |
| Molecular Formula | C9H11OW2Y- |
| Molecular Weight | 591.77 g/mol |
| Exact Mass | 591.89 |
| IUPAC Name | (3-ethylbenzene-5-id-1-yl)methanol;tungsten;yttrium |
| SMILES | CCc1c[c-]cc(CO)c1.[W].[W].[Y] |
| InChI | InChI=1S/C9H11O.2W.Y/c1-2-8-4-3-5-9(6-8)7-10;;;/h4-6,10H,2,7H2,1H3;;;/q-1;;; |
| InChIKey | GGELWIQOSWFYAG-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 591.77 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze (3-ethylbenzene-5-id-1-yl)methanol;tungsten;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethylbenzene-5-id-1-yl)methanol;tungsten;yttrium?
The IUPAC name of (3-ethylbenzene-5-id-1-yl)methanol;tungsten;yttrium (CID 161087005) is (3-ethylbenzene-5-id-1-yl)methanol;tungsten;yttrium.
What is the SMILES notation for (3-ethylbenzene-5-id-1-yl)methanol;tungsten;yttrium?
The canonical SMILES for (3-ethylbenzene-5-id-1-yl)methanol;tungsten;yttrium is CCc1c[c-]cc(CO)c1.[W].[W].[Y].
What is the InChIKey of (3-ethylbenzene-5-id-1-yl)methanol;tungsten;yttrium?
The InChIKey is GGELWIQOSWFYAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11O.2W.Y/c1-2-8-4-3-5-9(6-8)7-10;;;/h4-6,10H,2,7H2,1H3;;;/q-1;;;.
What are the key properties of (3-ethylbenzene-5-id-1-yl)methanol;tungsten;yttrium?
(3-ethylbenzene-5-id-1-yl)methanol;tungsten;yttrium has a molecular weight of 591.77 g/mol, XLogP of 1.53, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethylbenzene-5-id-1-yl)methanol;tungsten;yttrium is sourced from PubChem (CID 161087005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).