C21H29N3NaO2 — CID 161088748
CID 161088748 (PubChem CID 161088748) has the molecular formula C21H29N3NaO2 and a molecular weight of 378.47 g/mol.
| Compound Name | CID 161088748 |
|---|---|
| PubChem CID | 161088748 |
| Molecular Formula | C21H29N3NaO2 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | — |
| SMILES | [Na].c1cncc(CCN(CCCOC2CCCCO2)Cc2ccncc2)c1 |
| InChI | InChI=1S/C21H29N3O2.Na/c1-2-15-25-21(6-1)26-16-4-13-24(18-20-7-11-22-12-8-20)14-9-19-5-3-10-23-17-19;/h3,5,7-8,10-12,17,21H,1-2,4,6,9,13-16,18H2; |
| InChIKey | UGWPOOKRVIBYCT-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|