About 2,7-ditert-butylpyrene;ethane
2,7-ditert-butylpyrene;ethane (PubChem CID 161091366) has the molecular formula C28H38
and a molecular weight of 374.61 g/mol. Its IUPAC name is 2,7-ditert-butylpyrene;ethane.
Molecular Properties
| Compound Name | 2,7-ditert-butylpyrene;ethane |
| PubChem CID | 161091366 |
| Molecular Formula | C28H38 |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 374.30 |
| IUPAC Name | 2,7-ditert-butylpyrene;ethane |
| SMILES | CC.CC.CC(C)(C)c1cc2ccc3cc(C(C)(C)C)cc4ccc(c1)c2c34 |
| InChI | InChI=1S/C24H26.2C2H6/c1-23(2,3)19-11-15-7-9-17-13-20(24(4,5)6)14-18-10-8-16(12-19)21(15)22(17)18;2*1-2/h7-14H,1-6H3;2*1-2H3 |
| InChIKey | UHFJZZJHMSILGD-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2,7-ditert-butylpyrene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-ditert-butylpyrene;ethane?
The IUPAC name of 2,7-ditert-butylpyrene;ethane (CID 161091366) is 2,7-ditert-butylpyrene;ethane.
What is the SMILES notation for 2,7-ditert-butylpyrene;ethane?
The canonical SMILES for 2,7-ditert-butylpyrene;ethane is CC.CC.CC(C)(C)c1cc2ccc3cc(C(C)(C)C)cc4ccc(c1)c2c34.
What is the InChIKey of 2,7-ditert-butylpyrene;ethane?
The InChIKey is UHFJZZJHMSILGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26.2C2H6/c1-23(2,3)19-11-15-7-9-17-13-20(24(4,5)6)14-18-10-8-16(12-19)21(15)22(17)18;2*1-2/h7-14H,1-6H3;2*1-2H3.
What are the key properties of 2,7-ditert-butylpyrene;ethane?
2,7-ditert-butylpyrene;ethane has a molecular weight of 374.61 g/mol, XLogP of 9.23, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-ditert-butylpyrene;ethane is sourced from PubChem (CID 161091366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).