C19H35NO2 — CID 161091492
5-[cyclohex-2-en-1-yl(hydroxy)methyl]-1,4,4,5-tetramethyl-3-propylpyrrolidin-2-one;methane (PubChem CID 161091492) has the molecular formula C19H35NO2 and a molecular weight of 309.49 g/mol. Its IUPAC name is 5-[cyclohex-2-en-1-yl(hydroxy)methyl]-1,4,4,5-tetramethyl-3-propylpyrrolidin-2-one;methane.
| Compound Name | 5-[cyclohex-2-en-1-yl(hydroxy)methyl]-1,4,4,5-tetramethyl-3-propylpyrrolidin-2-one;methane |
|---|---|
| PubChem CID | 161091492 |
| Molecular Formula | C19H35NO2 |
| Molecular Weight | 309.49 g/mol |
| Exact Mass | 309.27 |
| IUPAC Name | 5-[cyclohex-2-en-1-yl(hydroxy)methyl]-1,4,4,5-tetramethyl-3-propylpyrrolidin-2-one;methane |
| SMILES | C.CCCC1C(=O)N(C)C(C)(C(O)C2C=CCCC2)C1(C)C |
| InChI | InChI=1S/C18H31NO2.CH4/c1-6-10-14-16(21)19(5)18(4,17(14,2)3)15(20)13-11-8-7-9-12-13;/h8,11,13-15,20H,6-7,9-10,12H2,1-5H3;1H4 |
| InChIKey | UHFUFBYYBCIWDA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.49 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|