C45H33F3O6 — CID 161092066
3-fluoro-4-[(1S,2R,3S,4R)-2-(2-fluoro-4-formyloxyphenyl)-3,4-diphenylcyclobutyl]benzoic acid;3-fluoro-4-[(E)-2-phenylethenyl]benzoic acid (PubChem CID 161092066) has the molecular formula C45H33F3O6 and a molecular weight of 726.75 g/mol. Its IUPAC name is 3-fluoro-4-[(1S,2R,3S,4R)-2-(2-fluoro-4-formyloxyphenyl)-3,4-diphenylcyclobutyl]benzoic acid;3-fluoro-4-[(E)-2-phenylethenyl]benzoic acid.
| Compound Name | 3-fluoro-4-[(1S,2R,3S,4R)-2-(2-fluoro-4-formyloxyphenyl)-3,4-diphenylcyclobutyl]benzoic acid;3-fluoro-4-[(E)-2-phenylethenyl]benzoic acid |
|---|---|
| PubChem CID | 161092066 |
| Molecular Formula | C45H33F3O6 |
| Molecular Weight | 726.75 g/mol |
| Exact Mass | 726.22 |
| IUPAC Name | 3-fluoro-4-[(1S,2R,3S,4R)-2-(2-fluoro-4-formyloxyphenyl)-3,4-diphenylcyclobutyl]benzoic acid;3-fluoro-4-[(E)-2-phenylethenyl]benzoic acid |
| SMILES | O=C(O)c1ccc(/C=C/c2ccccc2)c(F)c1.O=COc1ccc([C@@H]2[C@@H](c3ccccc3)[C@@H](c3ccccc3)[C@@H]2c2ccc(C(=O)O)cc2F)c(F)c1 |
| InChI | InChI=1S/C30H22F2O4.C15H11FO2/c31-24-15-20(30(34)35)11-13-22(24)28-26(18-7-3-1-4-8-18)27(19-9-5-2-6-10-19)29(28)23-14-12-21(36-17-33)16-25(23)32;16-14-10-13(15(17)18)9-8-12(14)7-6-11-4-2-1-3-5-11/h1-17,26-29H,(H,34,35);1-10H,(H,17,18)/b;7-6+/t26-,27+,28+,29-;/m1./s1 |
| InChIKey | UHHTULLZTYEUNA-SOQLZLJQSA-N |
| XLogP | 10.34 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.75 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|