About 2-(chloromethyl)-5-hydroxypyran-4-one;5-hydroxy-2-methylpyran-4-one;methane
2-(chloromethyl)-5-hydroxypyran-4-one;5-hydroxy-2-methylpyran-4-one;methane (PubChem CID 161092381) has the molecular formula C14H19ClO6
and a molecular weight of 318.75 g/mol. Its IUPAC name is 2-(chloromethyl)-5-hydroxypyran-4-one;5-hydroxy-2-methylpyran-4-one;methane.
Molecular Properties
| Compound Name | 2-(chloromethyl)-5-hydroxypyran-4-one;5-hydroxy-2-methylpyran-4-one;methane |
| PubChem CID | 161092381 |
| Molecular Formula | C14H19ClO6 |
| Molecular Weight | 318.75 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 2-(chloromethyl)-5-hydroxypyran-4-one;5-hydroxy-2-methylpyran-4-one;methane |
| SMILES | C.C.Cc1cc(=O)c(O)co1.O=c1cc(CCl)occ1O |
| InChI | InChI=1S/C6H5ClO3.C6H6O3.2CH4/c7-2-4-1-5(8)6(9)3-10-4;1-4-2-5(7)6(8)3-9-4;;/h1,3,9H,2H2;2-3,8H,1H3;2*1H4 |
| InChIKey | UHIUYNQRNQHRBO-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.75 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(chloromethyl)-5-hydroxypyran-4-one;5-hydroxy-2-methylpyran-4-one;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(chloromethyl)-5-hydroxypyran-4-one;5-hydroxy-2-methylpyran-4-one;methane?
The IUPAC name of 2-(chloromethyl)-5-hydroxypyran-4-one;5-hydroxy-2-methylpyran-4-one;methane (CID 161092381) is 2-(chloromethyl)-5-hydroxypyran-4-one;5-hydroxy-2-methylpyran-4-one;methane.
What is the SMILES notation for 2-(chloromethyl)-5-hydroxypyran-4-one;5-hydroxy-2-methylpyran-4-one;methane?
The canonical SMILES for 2-(chloromethyl)-5-hydroxypyran-4-one;5-hydroxy-2-methylpyran-4-one;methane is C.C.Cc1cc(=O)c(O)co1.O=c1cc(CCl)occ1O.
What is the InChIKey of 2-(chloromethyl)-5-hydroxypyran-4-one;5-hydroxy-2-methylpyran-4-one;methane?
The InChIKey is UHIUYNQRNQHRBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClO3.C6H6O3.2CH4/c7-2-4-1-5(8)6(9)3-10-4;1-4-2-5(7)6(8)3-9-4;;/h1,3,9H,2H2;2-3,8H,1H3;2*1H4.
What are the key properties of 2-(chloromethyl)-5-hydroxypyran-4-one;5-hydroxy-2-methylpyran-4-one;methane?
2-(chloromethyl)-5-hydroxypyran-4-one;5-hydroxy-2-methylpyran-4-one;methane has a molecular weight of 318.75 g/mol, XLogP of 3.01, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(chloromethyl)-5-hydroxypyran-4-one;5-hydroxy-2-methylpyran-4-one;methane is sourced from PubChem (CID 161092381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).