About 2-chloroacetyl chloride;2-chloro-N-(4-fluorophenyl)acetamide
2-chloroacetyl chloride;2-chloro-N-(4-fluorophenyl)acetamide (PubChem CID 161093004) has the molecular formula C10H9Cl3FNO2
and a molecular weight of 300.54 g/mol. Its IUPAC name is 2-chloroacetyl chloride;2-chloro-N-(4-fluorophenyl)acetamide.
Molecular Properties
| Compound Name | 2-chloroacetyl chloride;2-chloro-N-(4-fluorophenyl)acetamide |
| PubChem CID | 161093004 |
| Molecular Formula | C10H9Cl3FNO2 |
| Molecular Weight | 300.54 g/mol |
| Exact Mass | 298.97 |
| IUPAC Name | 2-chloroacetyl chloride;2-chloro-N-(4-fluorophenyl)acetamide |
| SMILES | O=C(CCl)Nc1ccc(F)cc1.O=C(Cl)CCl |
| InChI | InChI=1S/C8H7ClFNO.C2H2Cl2O/c9-5-8(12)11-7-3-1-6(10)2-4-7;3-1-2(4)5/h1-4H,5H2,(H,11,12);1H2 |
| InChIKey | UHKSTDVRGPKHNE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.54 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloroacetyl chloride;2-chloro-N-(4-fluorophenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloroacetyl chloride;2-chloro-N-(4-fluorophenyl)acetamide?
The IUPAC name of 2-chloroacetyl chloride;2-chloro-N-(4-fluorophenyl)acetamide (CID 161093004) is 2-chloroacetyl chloride;2-chloro-N-(4-fluorophenyl)acetamide.
What is the SMILES notation for 2-chloroacetyl chloride;2-chloro-N-(4-fluorophenyl)acetamide?
The canonical SMILES for 2-chloroacetyl chloride;2-chloro-N-(4-fluorophenyl)acetamide is O=C(CCl)Nc1ccc(F)cc1.O=C(Cl)CCl.
What is the InChIKey of 2-chloroacetyl chloride;2-chloro-N-(4-fluorophenyl)acetamide?
The InChIKey is UHKSTDVRGPKHNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClFNO.C2H2Cl2O/c9-5-8(12)11-7-3-1-6(10)2-4-7;3-1-2(4)5/h1-4H,5H2,(H,11,12);1H2.
What are the key properties of 2-chloroacetyl chloride;2-chloro-N-(4-fluorophenyl)acetamide?
2-chloroacetyl chloride;2-chloro-N-(4-fluorophenyl)acetamide has a molecular weight of 300.54 g/mol, XLogP of 2.99, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroacetyl chloride;2-chloro-N-(4-fluorophenyl)acetamide is sourced from PubChem (CID 161093004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).