About 7-bromo-3-methyl-3,4-dihydro-2H-naphthalen-1-one;2-methylbutanoic acid
7-bromo-3-methyl-3,4-dihydro-2H-naphthalen-1-one;2-methylbutanoic acid (PubChem CID 161093393) has the molecular formula C16H21BrO3
and a molecular weight of 341.25 g/mol. Its IUPAC name is 7-bromo-3-methyl-3,4-dihydro-2H-naphthalen-1-one;2-methylbutanoic acid.
Molecular Properties
| Compound Name | 7-bromo-3-methyl-3,4-dihydro-2H-naphthalen-1-one;2-methylbutanoic acid |
| PubChem CID | 161093393 |
| Molecular Formula | C16H21BrO3 |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 7-bromo-3-methyl-3,4-dihydro-2H-naphthalen-1-one;2-methylbutanoic acid |
| SMILES | CC1CC(=O)c2cc(Br)ccc2C1.CCC(C)C(=O)O |
| InChI | InChI=1S/C11H11BrO.C5H10O2/c1-7-4-8-2-3-9(12)6-10(8)11(13)5-7;1-3-4(2)5(6)7/h2-3,6-7H,4-5H2,1H3;4H,3H2,1-2H3,(H,6,7) |
| InChIKey | UHLXZZUOBHZCHO-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-bromo-3-methyl-3,4-dihydro-2H-naphthalen-1-one;2-methylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-3-methyl-3,4-dihydro-2H-naphthalen-1-one;2-methylbutanoic acid?
The IUPAC name of 7-bromo-3-methyl-3,4-dihydro-2H-naphthalen-1-one;2-methylbutanoic acid (CID 161093393) is 7-bromo-3-methyl-3,4-dihydro-2H-naphthalen-1-one;2-methylbutanoic acid.
What is the SMILES notation for 7-bromo-3-methyl-3,4-dihydro-2H-naphthalen-1-one;2-methylbutanoic acid?
The canonical SMILES for 7-bromo-3-methyl-3,4-dihydro-2H-naphthalen-1-one;2-methylbutanoic acid is CC1CC(=O)c2cc(Br)ccc2C1.CCC(C)C(=O)O.
What is the InChIKey of 7-bromo-3-methyl-3,4-dihydro-2H-naphthalen-1-one;2-methylbutanoic acid?
The InChIKey is UHLXZZUOBHZCHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrO.C5H10O2/c1-7-4-8-2-3-9(12)6-10(8)11(13)5-7;1-3-4(2)5(6)7/h2-3,6-7H,4-5H2,1H3;4H,3H2,1-2H3,(H,6,7).
What are the key properties of 7-bromo-3-methyl-3,4-dihydro-2H-naphthalen-1-one;2-methylbutanoic acid?
7-bromo-3-methyl-3,4-dihydro-2H-naphthalen-1-one;2-methylbutanoic acid has a molecular weight of 341.25 g/mol, XLogP of 4.33, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-3-methyl-3,4-dihydro-2H-naphthalen-1-one;2-methylbutanoic acid is sourced from PubChem (CID 161093393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).