About tert-butyl 3-[(2-ethyl-1,3-thiazol-4-yl)sulfanyl]-5-(1-methylpyrazol-4-yl)benzoate
tert-butyl 3-[(2-ethyl-1,3-thiazol-4-yl)sulfanyl]-5-(1-methylpyrazol-4-yl)benzoate (PubChem CID 161093619) has the molecular formula C20H23N3O2S2
and a molecular weight of 401.56 g/mol. Its IUPAC name is tert-butyl 3-[(2-ethyl-1,3-thiazol-4-yl)sulfanyl]-5-(1-methylpyrazol-4-yl)benzoate.
Molecular Properties
| Compound Name | tert-butyl 3-[(2-ethyl-1,3-thiazol-4-yl)sulfanyl]-5-(1-methylpyrazol-4-yl)benzoate |
| PubChem CID | 161093619 |
| Molecular Formula | C20H23N3O2S2 |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | tert-butyl 3-[(2-ethyl-1,3-thiazol-4-yl)sulfanyl]-5-(1-methylpyrazol-4-yl)benzoate |
| SMILES | CCc1nc(Sc2cc(C(=O)OC(C)(C)C)cc(-c3cnn(C)c3)c2)cs1 |
| InChI | InChI=1S/C20H23N3O2S2/c1-6-17-22-18(12-26-17)27-16-8-13(15-10-21-23(5)11-15)7-14(9-16)19(24)25-20(2,3)4/h7-12H,6H2,1-5H3 |
| InChIKey | WAUMUZMPBMQJPA-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze tert-butyl 3-[(2-ethyl-1,3-thiazol-4-yl)sulfanyl]-5-(1-methylpyrazol-4-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-[(2-ethyl-1,3-thiazol-4-yl)sulfanyl]-5-(1-methylpyrazol-4-yl)benzoate?
The IUPAC name of tert-butyl 3-[(2-ethyl-1,3-thiazol-4-yl)sulfanyl]-5-(1-methylpyrazol-4-yl)benzoate (CID 161093619) is tert-butyl 3-[(2-ethyl-1,3-thiazol-4-yl)sulfanyl]-5-(1-methylpyrazol-4-yl)benzoate.
What is the SMILES notation for tert-butyl 3-[(2-ethyl-1,3-thiazol-4-yl)sulfanyl]-5-(1-methylpyrazol-4-yl)benzoate?
The canonical SMILES for tert-butyl 3-[(2-ethyl-1,3-thiazol-4-yl)sulfanyl]-5-(1-methylpyrazol-4-yl)benzoate is CCc1nc(Sc2cc(C(=O)OC(C)(C)C)cc(-c3cnn(C)c3)c2)cs1.
What is the InChIKey of tert-butyl 3-[(2-ethyl-1,3-thiazol-4-yl)sulfanyl]-5-(1-methylpyrazol-4-yl)benzoate?
The InChIKey is WAUMUZMPBMQJPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23N3O2S2/c1-6-17-22-18(12-26-17)27-16-8-13(15-10-21-23(5)11-15)7-14(9-16)19(24)25-20(2,3)4/h7-12H,6H2,1-5H3.
What are the key properties of tert-butyl 3-[(2-ethyl-1,3-thiazol-4-yl)sulfanyl]-5-(1-methylpyrazol-4-yl)benzoate?
tert-butyl 3-[(2-ethyl-1,3-thiazol-4-yl)sulfanyl]-5-(1-methylpyrazol-4-yl)benzoate has a molecular weight of 401.56 g/mol, XLogP of 5.21, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-[(2-ethyl-1,3-thiazol-4-yl)sulfanyl]-5-(1-methylpyrazol-4-yl)benzoate is sourced from PubChem (CID 161093619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).