About 5-bromo-2-methoxyaniline;2-(5-bromo-2-methoxyphenyl)iminoethanethial
5-bromo-2-methoxyaniline;2-(5-bromo-2-methoxyphenyl)iminoethanethial (PubChem CID 161093799) has the molecular formula C16H16Br2N2O2S
and a molecular weight of 460.19 g/mol. Its IUPAC name is 5-bromo-2-methoxyaniline;2-(5-bromo-2-methoxyphenyl)iminoethanethial.
Molecular Properties
| Compound Name | 5-bromo-2-methoxyaniline;2-(5-bromo-2-methoxyphenyl)iminoethanethial |
| PubChem CID | 161093799 |
| Molecular Formula | C16H16Br2N2O2S |
| Molecular Weight | 460.19 g/mol |
| Exact Mass | 457.93 |
| IUPAC Name | 5-bromo-2-methoxyaniline;2-(5-bromo-2-methoxyphenyl)iminoethanethial |
| SMILES | COc1ccc(Br)cc1/N=C/C=S.COc1ccc(Br)cc1N |
| InChI | InChI=1S/C9H8BrNOS.C7H8BrNO/c1-12-9-3-2-7(10)6-8(9)11-4-5-13;1-10-7-3-2-5(8)4-6(7)9/h2-6H,1H3;2-4H,9H2,1H3/b11-4+; |
| InChIKey | UHNFDGZNUBORNC-SODSUQDMSA-N |
| XLogP | 5.20 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.19 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-methoxyaniline;2-(5-bromo-2-methoxyphenyl)iminoethanethial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-methoxyaniline;2-(5-bromo-2-methoxyphenyl)iminoethanethial?
The IUPAC name of 5-bromo-2-methoxyaniline;2-(5-bromo-2-methoxyphenyl)iminoethanethial (CID 161093799) is 5-bromo-2-methoxyaniline;2-(5-bromo-2-methoxyphenyl)iminoethanethial.
What is the SMILES notation for 5-bromo-2-methoxyaniline;2-(5-bromo-2-methoxyphenyl)iminoethanethial?
The canonical SMILES for 5-bromo-2-methoxyaniline;2-(5-bromo-2-methoxyphenyl)iminoethanethial is COc1ccc(Br)cc1/N=C/C=S.COc1ccc(Br)cc1N.
What is the InChIKey of 5-bromo-2-methoxyaniline;2-(5-bromo-2-methoxyphenyl)iminoethanethial?
The InChIKey is UHNFDGZNUBORNC-SODSUQDMSA-N. The full InChI is InChI=1S/C9H8BrNOS.C7H8BrNO/c1-12-9-3-2-7(10)6-8(9)11-4-5-13;1-10-7-3-2-5(8)4-6(7)9/h2-6H,1H3;2-4H,9H2,1H3/b11-4+;.
What are the key properties of 5-bromo-2-methoxyaniline;2-(5-bromo-2-methoxyphenyl)iminoethanethial?
5-bromo-2-methoxyaniline;2-(5-bromo-2-methoxyphenyl)iminoethanethial has a molecular weight of 460.19 g/mol, XLogP of 5.20, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-methoxyaniline;2-(5-bromo-2-methoxyphenyl)iminoethanethial is sourced from PubChem (CID 161093799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).