About 1H-benzimidazole;1,3-benzoxazole;stannane
1H-benzimidazole;1,3-benzoxazole;stannane (PubChem CID 161094065) has the molecular formula C14H15N3OSn
and a molecular weight of 360.01 g/mol. Its IUPAC name is 1H-benzimidazole;1,3-benzoxazole;stannane.
Molecular Properties
| Compound Name | 1H-benzimidazole;1,3-benzoxazole;stannane |
| PubChem CID | 161094065 |
| Molecular Formula | C14H15N3OSn |
| Molecular Weight | 360.01 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | 1H-benzimidazole;1,3-benzoxazole;stannane |
| SMILES | [SnH4].c1ccc2[nH]cnc2c1.c1ccc2ocnc2c1 |
| InChI | InChI=1S/C7H6N2.C7H5NO.Sn.4H/c2*1-2-4-7-6(3-1)8-5-9-7;;;;;/h1-5H,(H,8,9);1-5H;;;;; |
| InChIKey | UHOFAQXLMIWXGQ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.01 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-benzimidazole;1,3-benzoxazole;stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-benzimidazole;1,3-benzoxazole;stannane?
The IUPAC name of 1H-benzimidazole;1,3-benzoxazole;stannane (CID 161094065) is 1H-benzimidazole;1,3-benzoxazole;stannane.
What is the SMILES notation for 1H-benzimidazole;1,3-benzoxazole;stannane?
The canonical SMILES for 1H-benzimidazole;1,3-benzoxazole;stannane is [SnH4].c1ccc2[nH]cnc2c1.c1ccc2ocnc2c1.
What is the InChIKey of 1H-benzimidazole;1,3-benzoxazole;stannane?
The InChIKey is UHOFAQXLMIWXGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2.C7H5NO.Sn.4H/c2*1-2-4-7-6(3-1)8-5-9-7;;;;;/h1-5H,(H,8,9);1-5H;;;;;.
What are the key properties of 1H-benzimidazole;1,3-benzoxazole;stannane?
1H-benzimidazole;1,3-benzoxazole;stannane has a molecular weight of 360.01 g/mol, XLogP of 1.94, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-benzimidazole;1,3-benzoxazole;stannane is sourced from PubChem (CID 161094065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).