C47H52N14 — CID 161096676
6-N-(4-aminobutyl)-4-N-benzyl-2-N-naphthalen-1-yl-1,3,5-triazine-2,4,6-triamine;6-N-(3-aminopropyl)-4-N-benzyl-2-N-naphthalen-1-yl-1,3,5-triazine-2,4,6-triamine (PubChem CID 161096676) has the molecular formula C47H52N14 and a molecular weight of 813.03 g/mol. Its IUPAC name is 6-N-(4-aminobutyl)-4-N-benzyl-2-N-naphthalen-1-yl-1,3,5-triazine-2,4,6-triamine;6-N-(3-aminopropyl)-4-N-benzyl-2-N-naphthalen-1-yl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-(4-aminobutyl)-4-N-benzyl-2-N-naphthalen-1-yl-1,3,5-triazine-2,4,6-triamine;6-N-(3-aminopropyl)-4-N-benzyl-2-N-naphthalen-1-yl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 161096676 |
| Molecular Formula | C47H52N14 |
| Molecular Weight | 813.03 g/mol |
| Exact Mass | 812.45 |
| IUPAC Name | 6-N-(4-aminobutyl)-4-N-benzyl-2-N-naphthalen-1-yl-1,3,5-triazine-2,4,6-triamine;6-N-(3-aminopropyl)-4-N-benzyl-2-N-naphthalen-1-yl-1,3,5-triazine-2,4,6-triamine |
| SMILES | NCCCCNc1nc(NCc2ccccc2)nc(Nc2cccc3ccccc23)n1.NCCCNc1nc(NCc2ccccc2)nc(Nc2cccc3ccccc23)n1 |
| InChI | InChI=1S/C24H27N7.C23H25N7/c25-15-6-7-16-26-22-29-23(27-17-18-9-2-1-3-10-18)31-24(30-22)28-21-14-8-12-19-11-4-5-13-20(19)21;24-14-7-15-25-21-28-22(26-16-17-8-2-1-3-9-17)30-23(29-21)27-20-13-6-11-18-10-4-5-12-19(18)20/h1-5,8-14H,6-7,15-17,25H2,(H3,26,27,28,29,30,31);1-6,8-13H,7,14-16,24H2,(H3,25,26,27,28,29,30) |
| InChIKey | UHWSUDWNDLSAOL-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 201.56 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 61 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.03 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|