About 3-chloro-1,5-dimethyl-2-methylidenepyridine
3-chloro-1,5-dimethyl-2-methylidenepyridine (PubChem CID 161096937) has the molecular formula C8H10ClN
and a molecular weight of 155.63 g/mol. Its IUPAC name is 3-chloro-1,5-dimethyl-2-methylidenepyridine.
Molecular Properties
| Compound Name | 3-chloro-1,5-dimethyl-2-methylidenepyridine |
| PubChem CID | 161096937 |
| Molecular Formula | C8H10ClN |
| Molecular Weight | 155.63 g/mol |
| Exact Mass | 155.05 |
| IUPAC Name | 3-chloro-1,5-dimethyl-2-methylidenepyridine |
| SMILES | C=C1C(Cl)=CC(C)=CN1C |
| InChI | InChI=1S/C8H10ClN/c1-6-4-8(9)7(2)10(3)5-6/h4-5H,2H2,1,3H3 |
| InChIKey | BWFKNPWHAGJTCT-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.63 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-chloro-1,5-dimethyl-2-methylidenepyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-1,5-dimethyl-2-methylidenepyridine?
The IUPAC name of 3-chloro-1,5-dimethyl-2-methylidenepyridine (CID 161096937) is 3-chloro-1,5-dimethyl-2-methylidenepyridine.
What is the SMILES notation for 3-chloro-1,5-dimethyl-2-methylidenepyridine?
The canonical SMILES for 3-chloro-1,5-dimethyl-2-methylidenepyridine is C=C1C(Cl)=CC(C)=CN1C.
What is the InChIKey of 3-chloro-1,5-dimethyl-2-methylidenepyridine?
The InChIKey is BWFKNPWHAGJTCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10ClN/c1-6-4-8(9)7(2)10(3)5-6/h4-5H,2H2,1,3H3.
What are the key properties of 3-chloro-1,5-dimethyl-2-methylidenepyridine?
3-chloro-1,5-dimethyl-2-methylidenepyridine has a molecular weight of 155.63 g/mol, XLogP of 2.47, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-1,5-dimethyl-2-methylidenepyridine is sourced from PubChem (CID 161096937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).