C28H41NO2 — CID 161097025
(2E,4E,6Z,8E)-N,3,7-trimethyl-N-[2-(1-methylcyclobutyl)-2-oxoethyl]-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide (PubChem CID 161097025) has the molecular formula C28H41NO2 and a molecular weight of 423.64 g/mol. Its IUPAC name is (2E,4E,6Z,8E)-N,3,7-trimethyl-N-[2-(1-methylcyclobutyl)-2-oxoethyl]-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide.
| Compound Name | (2E,4E,6Z,8E)-N,3,7-trimethyl-N-[2-(1-methylcyclobutyl)-2-oxoethyl]-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide |
|---|---|
| PubChem CID | 161097025 |
| Molecular Formula | C28H41NO2 |
| Molecular Weight | 423.64 g/mol |
| Exact Mass | 423.31 |
| IUPAC Name | (2E,4E,6Z,8E)-N,3,7-trimethyl-N-[2-(1-methylcyclobutyl)-2-oxoethyl]-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide |
| SMILES | CC1=C(/C=C/C(C)=C\C=C\C(C)=C\C(=O)N(C)CC(=O)C2(C)CCC2)C(C)(C)CCC1 |
| InChI | InChI=1S/C28H41NO2/c1-21(14-15-24-23(3)13-9-16-27(24,4)5)11-8-12-22(2)19-26(31)29(7)20-25(30)28(6)17-10-18-28/h8,11-12,14-15,19H,9-10,13,16-18,20H2,1-7H3/b12-8+,15-14+,21-11-,22-19+ |
| InChIKey | KSHBFLISTNCZHW-SMNGFFLOSA-N |
| XLogP | 6.74 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.64 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|