C29H25FN4O — CID 161097268
(5aR,6R,10aR)-3-(3-fluorophenyl)-6,10a-dimethyl-1-quinolin-4-yl-5,5a,6,10-tetrahydro-4H-indazolo[7,6-f][1,2]benzoxazole (PubChem CID 161097268) has the molecular formula C29H25FN4O and a molecular weight of 464.54 g/mol. Its IUPAC name is (5aR,6R,10aR)-3-(3-fluorophenyl)-6,10a-dimethyl-1-quinolin-4-yl-5,5a,6,10-tetrahydro-4H-indazolo[7,6-f][1,2]benzoxazole.
| Compound Name | (5aR,6R,10aR)-3-(3-fluorophenyl)-6,10a-dimethyl-1-quinolin-4-yl-5,5a,6,10-tetrahydro-4H-indazolo[7,6-f][1,2]benzoxazole |
|---|---|
| PubChem CID | 161097268 |
| Molecular Formula | C29H25FN4O |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | (5aR,6R,10aR)-3-(3-fluorophenyl)-6,10a-dimethyl-1-quinolin-4-yl-5,5a,6,10-tetrahydro-4H-indazolo[7,6-f][1,2]benzoxazole |
| SMILES | C[C@H]1c2oncc2C[C@@]2(C)c3c(c(-c4cccc(F)c4)nn3-c3ccnc4ccccc34)CC[C@H]12 |
| InChI | InChI=1S/C29H25FN4O/c1-17-23-11-10-22-26(18-6-5-7-20(30)14-18)33-34(25-12-13-31-24-9-4-3-8-21(24)25)28(22)29(23,2)15-19-16-32-35-27(17)19/h3-9,12-14,16-17,23H,10-11,15H2,1-2H3/t17-,23-,29-/m1/s1 |
| InChIKey | SLEKNICLVWOKRT-QZZDXIJXSA-N |
| XLogP | 6.39 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |