C22H27N3O5 — CID 161099223
N'-[[(4R,4aS,12bS)-4a-hydroxy-9-methyl-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]methyl]-N-methylpropanediamide (PubChem CID 161099223) has the molecular formula C22H27N3O5 and a molecular weight of 413.47 g/mol. Its IUPAC name is N'-[[(4R,4aS,12bS)-4a-hydroxy-9-methyl-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]methyl]-N-methylpropanediamide.
| Compound Name | N'-[[(4R,4aS,12bS)-4a-hydroxy-9-methyl-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]methyl]-N-methylpropanediamide |
|---|---|
| PubChem CID | 161099223 |
| Molecular Formula | C22H27N3O5 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | N'-[[(4R,4aS,12bS)-4a-hydroxy-9-methyl-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]methyl]-N-methylpropanediamide |
| SMILES | CNC(=O)CC(=O)NCN1CC[C@]23c4c5ccc(C)c4OC2C(=O)CC[C@@]3(O)[C@H]1C5 |
| InChI | InChI=1S/C22H27N3O5/c1-12-3-4-13-9-15-22(29)6-5-14(26)20-21(22,18(13)19(12)30-20)7-8-25(15)11-24-17(28)10-16(27)23-2/h3-4,15,20,29H,5-11H2,1-2H3,(H,23,27)(H,24,28)/t15-,20?,21+,22-/m1/s1 |
| InChIKey | JGMLEMZBDJGSIU-CRHZHNNNSA-N |
| XLogP | -0.07 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|