C26H29NO5 — CID 161099806
2-(4-methoxyphenyl)-N-(4-methylphenyl)acetamide;methyl 2-(4-methoxyphenyl)acetate (PubChem CID 161099806) has the molecular formula C26H29NO5 and a molecular weight of 435.52 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-N-(4-methylphenyl)acetamide;methyl 2-(4-methoxyphenyl)acetate.
| Compound Name | 2-(4-methoxyphenyl)-N-(4-methylphenyl)acetamide;methyl 2-(4-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 161099806 |
| Molecular Formula | C26H29NO5 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | 2-(4-methoxyphenyl)-N-(4-methylphenyl)acetamide;methyl 2-(4-methoxyphenyl)acetate |
| SMILES | COC(=O)Cc1ccc(OC)cc1.COc1ccc(CC(=O)Nc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C16H17NO2.C10H12O3/c1-12-3-7-14(8-4-12)17-16(18)11-13-5-9-15(19-2)10-6-13;1-12-9-5-3-8(4-6-9)7-10(11)13-2/h3-10H,11H2,1-2H3,(H,17,18);3-6H,7H2,1-2H3 |
| InChIKey | UIGQUCZYIMQOJD-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |