C42H44BBrN2O2 — CID 161100488
2-(3-bromophenyl)pyridine;(3,5-diethylphenyl)boronic acid;2-[3-(3,5-diethylphenyl)phenyl]pyridine (PubChem CID 161100488) has the molecular formula C42H44BBrN2O2 and a molecular weight of 699.54 g/mol. Its IUPAC name is 2-(3-bromophenyl)pyridine;(3,5-diethylphenyl)boronic acid;2-[3-(3,5-diethylphenyl)phenyl]pyridine.
| Compound Name | 2-(3-bromophenyl)pyridine;(3,5-diethylphenyl)boronic acid;2-[3-(3,5-diethylphenyl)phenyl]pyridine |
|---|---|
| PubChem CID | 161100488 |
| Molecular Formula | C42H44BBrN2O2 |
| Molecular Weight | 699.54 g/mol |
| Exact Mass | 698.27 |
| IUPAC Name | 2-(3-bromophenyl)pyridine;(3,5-diethylphenyl)boronic acid;2-[3-(3,5-diethylphenyl)phenyl]pyridine |
| SMILES | Brc1cccc(-c2ccccn2)c1.CCc1cc(CC)cc(-c2cccc(-c3ccccn3)c2)c1.CCc1cc(CC)cc(B(O)O)c1 |
| InChI | InChI=1S/C21H21N.C11H8BrN.C10H15BO2/c1-3-16-12-17(4-2)14-20(13-16)18-8-7-9-19(15-18)21-10-5-6-11-22-21;12-10-5-3-4-9(8-10)11-6-1-2-7-13-11;1-3-8-5-9(4-2)7-10(6-8)11(12)13/h5-15H,3-4H2,1-2H3;1-8H;5-7,12-13H,3-4H2,1-2H3 |
| InChIKey | UIIVACCPPUNSNC-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.54 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|