About 10-propan-2-yloxydecan-3-one;(E)-10-propan-2-yloxydec-4-en-3-one
10-propan-2-yloxydecan-3-one;(E)-10-propan-2-yloxydec-4-en-3-one (PubChem CID 161101050) has the molecular formula C26H50O4
and a molecular weight of 426.68 g/mol. Its IUPAC name is 10-propan-2-yloxydecan-3-one;(E)-10-propan-2-yloxydec-4-en-3-one.
Molecular Properties
| Compound Name | 10-propan-2-yloxydecan-3-one;(E)-10-propan-2-yloxydec-4-en-3-one |
| PubChem CID | 161101050 |
| Molecular Formula | C26H50O4 |
| Molecular Weight | 426.68 g/mol |
| Exact Mass | 426.37 |
| IUPAC Name | 10-propan-2-yloxydecan-3-one;(E)-10-propan-2-yloxydec-4-en-3-one |
| SMILES | CCC(=O)/C=C/CCCCCOC(C)C.CCC(=O)CCCCCCCOC(C)C |
| InChI | InChI=1S/C13H26O2.C13H24O2/c2*1-4-13(14)10-8-6-5-7-9-11-15-12(2)3/h12H,4-11H2,1-3H3;8,10,12H,4-7,9,11H2,1-3H3/b;10-8+ |
| InChIKey | UIKRWUONGHZDEN-GIJXAKAHSA-N |
| XLogP | 7.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.68 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 10-propan-2-yloxydecan-3-one;(E)-10-propan-2-yloxydec-4-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-propan-2-yloxydecan-3-one;(E)-10-propan-2-yloxydec-4-en-3-one?
The IUPAC name of 10-propan-2-yloxydecan-3-one;(E)-10-propan-2-yloxydec-4-en-3-one (CID 161101050) is 10-propan-2-yloxydecan-3-one;(E)-10-propan-2-yloxydec-4-en-3-one.
What is the SMILES notation for 10-propan-2-yloxydecan-3-one;(E)-10-propan-2-yloxydec-4-en-3-one?
The canonical SMILES for 10-propan-2-yloxydecan-3-one;(E)-10-propan-2-yloxydec-4-en-3-one is CCC(=O)/C=C/CCCCCOC(C)C.CCC(=O)CCCCCCCOC(C)C.
What is the InChIKey of 10-propan-2-yloxydecan-3-one;(E)-10-propan-2-yloxydec-4-en-3-one?
The InChIKey is UIKRWUONGHZDEN-GIJXAKAHSA-N. The full InChI is InChI=1S/C13H26O2.C13H24O2/c2*1-4-13(14)10-8-6-5-7-9-11-15-12(2)3/h12H,4-11H2,1-3H3;8,10,12H,4-7,9,11H2,1-3H3/b;10-8+.
What are the key properties of 10-propan-2-yloxydecan-3-one;(E)-10-propan-2-yloxydec-4-en-3-one?
10-propan-2-yloxydecan-3-one;(E)-10-propan-2-yloxydec-4-en-3-one has a molecular weight of 426.68 g/mol, XLogP of 7.24, 19 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-propan-2-yloxydecan-3-one;(E)-10-propan-2-yloxydec-4-en-3-one is sourced from PubChem (CID 161101050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).