C24H19N5O — CID 161101816
3-methoxy-5-(5-pyridin-4-yl-2-quinolin-5-yl-3H-pyrrol-4-yl)pyridin-2-amine (PubChem CID 161101816) has the molecular formula C24H19N5O and a molecular weight of 393.45 g/mol. Its IUPAC name is 3-methoxy-5-(5-pyridin-4-yl-2-quinolin-5-yl-3H-pyrrol-4-yl)pyridin-2-amine.
| Compound Name | 3-methoxy-5-(5-pyridin-4-yl-2-quinolin-5-yl-3H-pyrrol-4-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 161101816 |
| Molecular Formula | C24H19N5O |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 3-methoxy-5-(5-pyridin-4-yl-2-quinolin-5-yl-3H-pyrrol-4-yl)pyridin-2-amine |
| SMILES | COc1cc(C2=C(c3ccncc3)N=C(c3cccc4ncccc34)C2)cnc1N |
| InChI | InChI=1S/C24H19N5O/c1-30-22-12-16(14-28-24(22)25)19-13-21(29-23(19)15-7-10-26-11-8-15)18-4-2-6-20-17(18)5-3-9-27-20/h2-12,14H,13H2,1H3,(H2,25,28) |
| InChIKey | UINMPKBKSVKYEB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 86.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |