C21H30O4 — CID 161104698
(5Z)-9,9-dimethoxynona-1,5-dien-3-yne;methanol;(4Z)-nona-4,8-dien-6-ynal (PubChem CID 161104698) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is (5Z)-9,9-dimethoxynona-1,5-dien-3-yne;methanol;(4Z)-nona-4,8-dien-6-ynal.
| Compound Name | (5Z)-9,9-dimethoxynona-1,5-dien-3-yne;methanol;(4Z)-nona-4,8-dien-6-ynal |
|---|---|
| PubChem CID | 161104698 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | (5Z)-9,9-dimethoxynona-1,5-dien-3-yne;methanol;(4Z)-nona-4,8-dien-6-ynal |
| SMILES | C=CC#C/C=C\CCC(OC)OC.C=CC#C/C=C\CCC=O.CO |
| InChI | InChI=1S/C11H16O2.C9H10O.CH4O/c1-4-5-6-7-8-9-10-11(12-2)13-3;1-2-3-4-5-6-7-8-9-10;1-2/h4,7-8,11H,1,9-10H2,2-3H3;2,5-6,9H,1,7-8H2;2H,1H3/b8-7-;6-5-; |
| InChIKey | UIWVFYAPYYQXJU-FCDXFYGISA-N |
| XLogP | 3.45 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|