C11H23BrF4N2O2S — CID 161105306
trimethyl-[3-[(3,4,4,4-tetrafluoro-3-methylbutyl)sulfonylamino]propyl]azanium bromide (PubChem CID 161105306) has the molecular formula C11H23BrF4N2O2S and a molecular weight of 403.28 g/mol. Its IUPAC name is trimethyl-[3-[(3,4,4,4-tetrafluoro-3-methylbutyl)sulfonylamino]propyl]azanium bromide.
| Compound Name | trimethyl-[3-[(3,4,4,4-tetrafluoro-3-methylbutyl)sulfonylamino]propyl]azanium bromide |
|---|---|
| PubChem CID | 161105306 |
| Molecular Formula | C11H23BrF4N2O2S |
| Molecular Weight | 403.28 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | trimethyl-[3-[(3,4,4,4-tetrafluoro-3-methylbutyl)sulfonylamino]propyl]azanium bromide |
| SMILES | CC(F)(CCS(=O)(=O)NCCC[N+](C)(C)C)C(F)(F)F.[Br-] |
| InChI | InChI=1S/C11H23F4N2O2S.BrH/c1-10(12,11(13,14)15)6-9-20(18,19)16-7-5-8-17(2,3)4;/h16H,5-9H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | ZPBDEVZTUDKJQA-UHFFFAOYSA-M |
| XLogP | -1.31 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.28 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|