CH14N3O7P — CID 161106274
triazanium;hydrogen carbonate;hydrogen phosphate (PubChem CID 161106274) has the molecular formula CH14N3O7P and a molecular weight of 211.11 g/mol. Its IUPAC name is triazanium;hydrogen carbonate;hydrogen phosphate.
| Compound Name | triazanium;hydrogen carbonate;hydrogen phosphate |
|---|---|
| PubChem CID | 161106274 |
| Molecular Formula | CH14N3O7P |
| Molecular Weight | 211.11 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | triazanium;hydrogen carbonate;hydrogen phosphate |
| SMILES | O=C([O-])O.O=P([O-])([O-])O.[NH4+].[NH4+].[NH4+] |
| InChI | InChI=1S/CH2O3.3H3N.H3O4P/c2-1(3)4;;;;1-5(2,3)4/h(H2,2,3,4);3*1H3;(H3,1,2,3,4) |
| InChIKey | UJCBTFDEBVRXLC-UHFFFAOYSA-N |
| XLogP | -2.18 |
| TPSA | 253.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.11 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|