About 1-bromo-2-(difluoromethyl)naphthalene;1-bromonaphthalene-2-carbaldehyde
1-bromo-2-(difluoromethyl)naphthalene;1-bromonaphthalene-2-carbaldehyde (PubChem CID 161106897) has the molecular formula C22H14Br2F2O
and a molecular weight of 492.16 g/mol. Its IUPAC name is 1-bromo-2-(difluoromethyl)naphthalene;1-bromonaphthalene-2-carbaldehyde.
Molecular Properties
| Compound Name | 1-bromo-2-(difluoromethyl)naphthalene;1-bromonaphthalene-2-carbaldehyde |
| PubChem CID | 161106897 |
| Molecular Formula | C22H14Br2F2O |
| Molecular Weight | 492.16 g/mol |
| Exact Mass | 489.94 |
| IUPAC Name | 1-bromo-2-(difluoromethyl)naphthalene;1-bromonaphthalene-2-carbaldehyde |
| SMILES | FC(F)c1ccc2ccccc2c1Br.O=Cc1ccc2ccccc2c1Br |
| InChI | InChI=1S/C11H7BrF2.C11H7BrO/c12-10-8-4-2-1-3-7(8)5-6-9(10)11(13)14;12-11-9(7-13)6-5-8-3-1-2-4-10(8)11/h1-6,11H;1-7H |
| InChIKey | UJEAOECUUNRUQT-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 492.16 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-2-(difluoromethyl)naphthalene;1-bromonaphthalene-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2-(difluoromethyl)naphthalene;1-bromonaphthalene-2-carbaldehyde?
The IUPAC name of 1-bromo-2-(difluoromethyl)naphthalene;1-bromonaphthalene-2-carbaldehyde (CID 161106897) is 1-bromo-2-(difluoromethyl)naphthalene;1-bromonaphthalene-2-carbaldehyde.
What is the SMILES notation for 1-bromo-2-(difluoromethyl)naphthalene;1-bromonaphthalene-2-carbaldehyde?
The canonical SMILES for 1-bromo-2-(difluoromethyl)naphthalene;1-bromonaphthalene-2-carbaldehyde is FC(F)c1ccc2ccccc2c1Br.O=Cc1ccc2ccccc2c1Br.
What is the InChIKey of 1-bromo-2-(difluoromethyl)naphthalene;1-bromonaphthalene-2-carbaldehyde?
The InChIKey is UJEAOECUUNRUQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7BrF2.C11H7BrO/c12-10-8-4-2-1-3-7(8)5-6-9(10)11(13)14;12-11-9(7-13)6-5-8-3-1-2-4-10(8)11/h1-6,11H;1-7H.
What are the key properties of 1-bromo-2-(difluoromethyl)naphthalene;1-bromonaphthalene-2-carbaldehyde?
1-bromo-2-(difluoromethyl)naphthalene;1-bromonaphthalene-2-carbaldehyde has a molecular weight of 492.16 g/mol, XLogP of 7.95, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2-(difluoromethyl)naphthalene;1-bromonaphthalene-2-carbaldehyde is sourced from PubChem (CID 161106897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).