C20H21NO5 — CID 161106930
bis(carbon dioxide);N-[(1R)-1-(2,3-dimethyl-7-oxabicyclo[2.2.1]hepta-2,5-dien-1-yl)but-3-enyl]aniline (PubChem CID 161106930) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is bis(carbon dioxide);N-[(1R)-1-(2,3-dimethyl-7-oxabicyclo[2.2.1]hepta-2,5-dien-1-yl)but-3-enyl]aniline.
| Compound Name | bis(carbon dioxide);N-[(1R)-1-(2,3-dimethyl-7-oxabicyclo[2.2.1]hepta-2,5-dien-1-yl)but-3-enyl]aniline |
|---|---|
| PubChem CID | 161106930 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | bis(carbon dioxide);N-[(1R)-1-(2,3-dimethyl-7-oxabicyclo[2.2.1]hepta-2,5-dien-1-yl)but-3-enyl]aniline |
| SMILES | C=CC[C@@H](Nc1ccccc1)C12C=CC(O1)C(C)=C2C.O=C=O.O=C=O |
| InChI | InChI=1S/C18H21NO.2CO2/c1-4-8-17(19-15-9-6-5-7-10-15)18-12-11-16(20-18)13(2)14(18)3;2*2-1-3/h4-7,9-12,16-17,19H,1,8H2,2-3H3;;/t16?,17-,18?;;/m1../s1 |
| InChIKey | UJEDODUDWVRSFZ-JEFXZJGWSA-N |
| XLogP | 2.92 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|