C15H11NO9 — CID 161107281
3-amino-4,5,15,16,17-pentahydroxy-9,11-dioxatricyclo[11.4.0.02,7]heptadeca-1(17),2,4,6,13,15-hexaene-8,12-dione (PubChem CID 161107281) has the molecular formula C15H11NO9 and a molecular weight of 349.25 g/mol. Its IUPAC name is 3-amino-4,5,15,16,17-pentahydroxy-9,11-dioxatricyclo[11.4.0.02,7]heptadeca-1(17),2,4,6,13,15-hexaene-8,12-dione.
| Compound Name | 3-amino-4,5,15,16,17-pentahydroxy-9,11-dioxatricyclo[11.4.0.02,7]heptadeca-1(17),2,4,6,13,15-hexaene-8,12-dione |
|---|---|
| PubChem CID | 161107281 |
| Molecular Formula | C15H11NO9 |
| Molecular Weight | 349.25 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | 3-amino-4,5,15,16,17-pentahydroxy-9,11-dioxatricyclo[11.4.0.02,7]heptadeca-1(17),2,4,6,13,15-hexaene-8,12-dione |
| SMILES | Nc1c(O)c(O)cc2c1-c1c(cc(O)c(O)c1O)C(=O)OCOC2=O |
| InChI | InChI=1S/C15H11NO9/c16-10-8-4(1-6(17)11(10)19)14(22)24-3-25-15(23)5-2-7(18)12(20)13(21)9(5)8/h1-2,17-21H,3,16H2 |
| InChIKey | UJFLQLIMOVLNEV-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 179.77 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.25 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|