C33H24N4O5 — CID 161108130
2-(1,3-dioxoisoindol-2-yl)-1,2,3,4-tetrahydrocyclopenta[b]indole-7-carbonitrile;2-(3-oxocyclopentyl)isoindole-1,3-dione (PubChem CID 161108130) has the molecular formula C33H24N4O5 and a molecular weight of 556.58 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-1,2,3,4-tetrahydrocyclopenta[b]indole-7-carbonitrile;2-(3-oxocyclopentyl)isoindole-1,3-dione.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-1,2,3,4-tetrahydrocyclopenta[b]indole-7-carbonitrile;2-(3-oxocyclopentyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 161108130 |
| Molecular Formula | C33H24N4O5 |
| Molecular Weight | 556.58 g/mol |
| Exact Mass | 556.17 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-1,2,3,4-tetrahydrocyclopenta[b]indole-7-carbonitrile;2-(3-oxocyclopentyl)isoindole-1,3-dione |
| SMILES | N#Cc1ccc2[nH]c3c(c2c1)CC(N1C(=O)c2ccccc2C1=O)C3.O=C1CCC(N2C(=O)c3ccccc3C2=O)C1 |
| InChI | InChI=1S/C20H13N3O2.C13H11NO3/c21-10-11-5-6-17-15(7-11)16-8-12(9-18(16)22-17)23-19(24)13-3-1-2-4-14(13)20(23)25;15-9-6-5-8(7-9)14-12(16)10-3-1-2-4-11(10)13(14)17/h1-7,12,22H,8-9H2;1-4,8H,5-7H2 |
| InChIKey | UJIGTBHZDRERTK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 131.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.58 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|