About tert-butyl 3-piperidin-2-ylpropanoate;tert-butyl 3-pyrazin-2-ylpropanoate
tert-butyl 3-piperidin-2-ylpropanoate;tert-butyl 3-pyrazin-2-ylpropanoate (PubChem CID 161111058) has the molecular formula C23H39N3O4
and a molecular weight of 421.58 g/mol. Its IUPAC name is tert-butyl 3-piperidin-2-ylpropanoate;tert-butyl 3-pyrazin-2-ylpropanoate.
Molecular Properties
| Compound Name | tert-butyl 3-piperidin-2-ylpropanoate;tert-butyl 3-pyrazin-2-ylpropanoate |
| PubChem CID | 161111058 |
| Molecular Formula | C23H39N3O4 |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.29 |
| IUPAC Name | tert-butyl 3-piperidin-2-ylpropanoate;tert-butyl 3-pyrazin-2-ylpropanoate |
| SMILES | CC(C)(C)OC(=O)CCC1CCCCN1.CC(C)(C)OC(=O)CCc1cnccn1 |
| InChI | InChI=1S/C12H23NO2.C11H16N2O2/c1-12(2,3)15-11(14)8-7-10-6-4-5-9-13-10;1-11(2,3)15-10(14)5-4-9-8-12-6-7-13-9/h10,13H,4-9H2,1-3H3;6-8H,4-5H2,1-3H3 |
| InChIKey | UJRRUQPGPWOGKT-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze tert-butyl 3-piperidin-2-ylpropanoate;tert-butyl 3-pyrazin-2-ylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-piperidin-2-ylpropanoate;tert-butyl 3-pyrazin-2-ylpropanoate?
The IUPAC name of tert-butyl 3-piperidin-2-ylpropanoate;tert-butyl 3-pyrazin-2-ylpropanoate (CID 161111058) is tert-butyl 3-piperidin-2-ylpropanoate;tert-butyl 3-pyrazin-2-ylpropanoate.
What is the SMILES notation for tert-butyl 3-piperidin-2-ylpropanoate;tert-butyl 3-pyrazin-2-ylpropanoate?
The canonical SMILES for tert-butyl 3-piperidin-2-ylpropanoate;tert-butyl 3-pyrazin-2-ylpropanoate is CC(C)(C)OC(=O)CCC1CCCCN1.CC(C)(C)OC(=O)CCc1cnccn1.
What is the InChIKey of tert-butyl 3-piperidin-2-ylpropanoate;tert-butyl 3-pyrazin-2-ylpropanoate?
The InChIKey is UJRRUQPGPWOGKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO2.C11H16N2O2/c1-12(2,3)15-11(14)8-7-10-6-4-5-9-13-10;1-11(2,3)15-10(14)5-4-9-8-12-6-7-13-9/h10,13H,4-9H2,1-3H3;6-8H,4-5H2,1-3H3.
What are the key properties of tert-butyl 3-piperidin-2-ylpropanoate;tert-butyl 3-pyrazin-2-ylpropanoate?
tert-butyl 3-piperidin-2-ylpropanoate;tert-butyl 3-pyrazin-2-ylpropanoate has a molecular weight of 421.58 g/mol, XLogP of 4.00, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-piperidin-2-ylpropanoate;tert-butyl 3-pyrazin-2-ylpropanoate is sourced from PubChem (CID 161111058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).