C32H38N4O2 — CID 161111304
N-[(5-methyl-2-nitrophenyl)methyl]-2-phenylethanamine;4-methyl-2-[(2-phenylethylamino)methyl]aniline (PubChem CID 161111304) has the molecular formula C32H38N4O2 and a molecular weight of 510.68 g/mol. Its IUPAC name is N-[(5-methyl-2-nitrophenyl)methyl]-2-phenylethanamine;4-methyl-2-[(2-phenylethylamino)methyl]aniline.
| Compound Name | N-[(5-methyl-2-nitrophenyl)methyl]-2-phenylethanamine;4-methyl-2-[(2-phenylethylamino)methyl]aniline |
|---|---|
| PubChem CID | 161111304 |
| Molecular Formula | C32H38N4O2 |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.30 |
| IUPAC Name | N-[(5-methyl-2-nitrophenyl)methyl]-2-phenylethanamine;4-methyl-2-[(2-phenylethylamino)methyl]aniline |
| SMILES | Cc1ccc(N)c(CNCCc2ccccc2)c1.Cc1ccc([N+](=O)[O-])c(CNCCc2ccccc2)c1 |
| InChI | InChI=1S/C16H18N2O2.C16H20N2/c1-13-7-8-16(18(19)20)15(11-13)12-17-10-9-14-5-3-2-4-6-14;1-13-7-8-16(17)15(11-13)12-18-10-9-14-5-3-2-4-6-14/h2-8,11,17H,9-10,12H2,1H3;2-8,11,18H,9-10,12,17H2,1H3 |
| InChIKey | UJSOHZDHBVTBTC-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 93.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|