C23H24N2OSi — CID 161113348
8-(diethylamino)-10-methyl-10-phenylbenzo[b][1,4]benzazasilin-2-one (PubChem CID 161113348) has the molecular formula C23H24N2OSi and a molecular weight of 372.54 g/mol. Its IUPAC name is 8-(diethylamino)-10-methyl-10-phenylbenzo[b][1,4]benzazasilin-2-one.
| Compound Name | 8-(diethylamino)-10-methyl-10-phenylbenzo[b][1,4]benzazasilin-2-one |
|---|---|
| PubChem CID | 161113348 |
| Molecular Formula | C23H24N2OSi |
| Molecular Weight | 372.54 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 8-(diethylamino)-10-methyl-10-phenylbenzo[b][1,4]benzazasilin-2-one |
| SMILES | CCN(CC)c1ccc2c(c1)[Si](C)(c1ccccc1)C1=CC(=O)C=CC1=N2 |
| InChI | InChI=1S/C23H24N2OSi/c1-4-25(5-2)17-11-13-20-22(15-17)27(3,19-9-7-6-8-10-19)23-16-18(26)12-14-21(23)24-20/h6-16H,4-5H2,1-3H3 |
| InChIKey | YZEQKVPYKDKFLZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.54 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|