About methane;methyl 6-bromo-1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylate
methane;methyl 6-bromo-1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylate (PubChem CID 161113355) has the molecular formula C19H25BrN2O3
and a molecular weight of 409.32 g/mol. Its IUPAC name is methane;methyl 6-bromo-1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylate.
Molecular Properties
| Compound Name | methane;methyl 6-bromo-1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylate |
| PubChem CID | 161113355 |
| Molecular Formula | C19H25BrN2O3 |
| Molecular Weight | 409.32 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | methane;methyl 6-bromo-1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylate |
| SMILES | C.COC(=O)c1cn(C/C=C/[C@H]2NCCC[C@@H]2O)c2cc(Br)ccc12 |
| InChI | InChI=1S/C18H21BrN2O3.CH4/c1-24-18(23)14-11-21(16-10-12(19)6-7-13(14)16)9-3-4-15-17(22)5-2-8-20-15;/h3-4,6-7,10-11,15,17,20,22H,2,5,8-9H2,1H3;1H4/b4-3+;/t15-,17+;/m1./s1 |
| InChIKey | UJZIZZAYHWKXGW-FGIKKRFZSA-N |
| XLogP | 3.50 |
| TPSA | 63.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methane;methyl 6-bromo-1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;methyl 6-bromo-1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylate?
The IUPAC name of methane;methyl 6-bromo-1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylate (CID 161113355) is methane;methyl 6-bromo-1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylate.
What is the SMILES notation for methane;methyl 6-bromo-1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylate?
The canonical SMILES for methane;methyl 6-bromo-1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylate is C.COC(=O)c1cn(C/C=C/[C@H]2NCCC[C@@H]2O)c2cc(Br)ccc12.
What is the InChIKey of methane;methyl 6-bromo-1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylate?
The InChIKey is UJZIZZAYHWKXGW-FGIKKRFZSA-N. The full InChI is InChI=1S/C18H21BrN2O3.CH4/c1-24-18(23)14-11-21(16-10-12(19)6-7-13(14)16)9-3-4-15-17(22)5-2-8-20-15;/h3-4,6-7,10-11,15,17,20,22H,2,5,8-9H2,1H3;1H4/b4-3+;/t15-,17+;/m1./s1.
What are the key properties of methane;methyl 6-bromo-1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylate?
methane;methyl 6-bromo-1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylate has a molecular weight of 409.32 g/mol, XLogP of 3.50, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methane;methyl 6-bromo-1-[(E)-3-[(2R,3S)-3-hydroxypiperidin-2-yl]prop-2-enyl]indole-3-carboxylate is sourced from PubChem (CID 161113355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).