C6H7F9 — CID 161114745
1,1,1,2,2-pentafluorobutane;1,1,1,2-tetrafluoroethane (PubChem CID 161114745) has the molecular formula C6H7F9 and a molecular weight of 250.10 g/mol. Its IUPAC name is 1,1,1,2,2-pentafluorobutane;1,1,1,2-tetrafluoroethane.
| Compound Name | 1,1,1,2,2-pentafluorobutane;1,1,1,2-tetrafluoroethane |
|---|---|
| PubChem CID | 161114745 |
| Molecular Formula | C6H7F9 |
| Molecular Weight | 250.10 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | 1,1,1,2,2-pentafluorobutane;1,1,1,2-tetrafluoroethane |
| SMILES | CCC(F)(F)C(F)(F)F.FCC(F)(F)F |
| InChI | InChI=1S/C4H5F5.C2H2F4/c1-2-3(5,6)4(7,8)9;3-1-2(4,5)6/h2H2,1H3;1H2 |
| InChIKey | UKDWRHXVZACXPJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.10 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|