C11H24BN3OP — CID 161117119
CID 161117119 (PubChem CID 161117119) has the molecular formula C11H24BN3OP and a molecular weight of 256.12 g/mol.
| Compound Name | CID 161117119 |
|---|---|
| PubChem CID | 161117119 |
| Molecular Formula | C11H24BN3OP |
| Molecular Weight | 256.12 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | — |
| SMILES | C.C[B]N1CCCC(c2noc(CC)n2)C1.P |
| InChI | InChI=1S/C10H17BN3O.CH4.H3P/c1-3-9-12-10(13-15-9)8-5-4-6-14(7-8)11-2;;/h8H,3-7H2,1-2H3;1H4;1H3 |
| InChIKey | IBUPEFLNIWNOSE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.12 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|