About hex-2-ene;3-methylpentane
hex-2-ene;3-methylpentane (PubChem CID 161117572) has the molecular formula C12H26
and a molecular weight of 170.34 g/mol. Its IUPAC name is hex-2-ene;3-methylpentane.
Molecular Properties
| Compound Name | hex-2-ene;3-methylpentane |
| PubChem CID | 161117572 |
| Molecular Formula | C12H26 |
| Molecular Weight | 170.34 g/mol |
| Exact Mass | 170.20 |
| IUPAC Name | hex-2-ene;3-methylpentane |
| SMILES | CC=CCCC.CCC(C)CC |
| InChI | InChI=1S/C6H14.C6H12/c1-4-6(3)5-2;1-3-5-6-4-2/h6H,4-5H2,1-3H3;3,5H,4,6H2,1-2H3 |
| InChIKey | UKNCCEITSWANTC-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.34 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze hex-2-ene;3-methylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hex-2-ene;3-methylpentane?
The IUPAC name of hex-2-ene;3-methylpentane (CID 161117572) is hex-2-ene;3-methylpentane.
What is the SMILES notation for hex-2-ene;3-methylpentane?
The canonical SMILES for hex-2-ene;3-methylpentane is CC=CCCC.CCC(C)CC.
What is the InChIKey of hex-2-ene;3-methylpentane?
The InChIKey is UKNCCEITSWANTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14.C6H12/c1-4-6(3)5-2;1-3-5-6-4-2/h6H,4-5H2,1-3H3;3,5H,4,6H2,1-2H3.
What are the key properties of hex-2-ene;3-methylpentane?
hex-2-ene;3-methylpentane has a molecular weight of 170.34 g/mol, XLogP of 4.81, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hex-2-ene;3-methylpentane is sourced from PubChem (CID 161117572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).