About 2-chloro-1,3-diphenyl-2H-imidazole;quinoline;hydrochloride
2-chloro-1,3-diphenyl-2H-imidazole;quinoline;hydrochloride (PubChem CID 161120060) has the molecular formula C24H21Cl2N3
and a molecular weight of 422.36 g/mol. Its IUPAC name is 2-chloro-1,3-diphenyl-2H-imidazole;quinoline;hydrochloride.
Molecular Properties
| Compound Name | 2-chloro-1,3-diphenyl-2H-imidazole;quinoline;hydrochloride |
| PubChem CID | 161120060 |
| Molecular Formula | C24H21Cl2N3 |
| Molecular Weight | 422.36 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | 2-chloro-1,3-diphenyl-2H-imidazole;quinoline;hydrochloride |
| SMILES | Cl.ClC1N(c2ccccc2)C=CN1c1ccccc1.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C15H13ClN2.C9H7N.ClH/c16-15-17(13-7-3-1-4-8-13)11-12-18(15)14-9-5-2-6-10-14;1-2-6-9-8(4-1)5-3-7-10-9;/h1-12,15H;1-7H;1H |
| InChIKey | UDUIWDIUOPWSJH-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.36 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-1,3-diphenyl-2H-imidazole;quinoline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1,3-diphenyl-2H-imidazole;quinoline;hydrochloride?
The IUPAC name of 2-chloro-1,3-diphenyl-2H-imidazole;quinoline;hydrochloride (CID 161120060) is 2-chloro-1,3-diphenyl-2H-imidazole;quinoline;hydrochloride.
What is the SMILES notation for 2-chloro-1,3-diphenyl-2H-imidazole;quinoline;hydrochloride?
The canonical SMILES for 2-chloro-1,3-diphenyl-2H-imidazole;quinoline;hydrochloride is Cl.ClC1N(c2ccccc2)C=CN1c1ccccc1.c1ccc2ncccc2c1.
What is the InChIKey of 2-chloro-1,3-diphenyl-2H-imidazole;quinoline;hydrochloride?
The InChIKey is UDUIWDIUOPWSJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13ClN2.C9H7N.ClH/c16-15-17(13-7-3-1-4-8-13)11-12-18(15)14-9-5-2-6-10-14;1-2-6-9-8(4-1)5-3-7-10-9;/h1-12,15H;1-7H;1H.
What are the key properties of 2-chloro-1,3-diphenyl-2H-imidazole;quinoline;hydrochloride?
2-chloro-1,3-diphenyl-2H-imidazole;quinoline;hydrochloride has a molecular weight of 422.36 g/mol, XLogP of 6.66, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1,3-diphenyl-2H-imidazole;quinoline;hydrochloride is sourced from PubChem (CID 161120060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).