About 5-chloro-2-(2,6-difluoro-4-hydroxyphenyl)-1-ethyl-3H-pyridin-3-id-6-one;yttrium
5-chloro-2-(2,6-difluoro-4-hydroxyphenyl)-1-ethyl-3H-pyridin-3-id-6-one;yttrium (PubChem CID 161120361) has the molecular formula C13H9ClF2NO2Y-
and a molecular weight of 373.58 g/mol. Its IUPAC name is 5-chloro-2-(2,6-difluoro-4-hydroxyphenyl)-1-ethyl-3H-pyridin-3-id-6-one;yttrium.
Molecular Properties
| Compound Name | 5-chloro-2-(2,6-difluoro-4-hydroxyphenyl)-1-ethyl-3H-pyridin-3-id-6-one;yttrium |
| PubChem CID | 161120361 |
| Molecular Formula | C13H9ClF2NO2Y- |
| Molecular Weight | 373.58 g/mol |
| Exact Mass | 372.94 |
| IUPAC Name | 5-chloro-2-(2,6-difluoro-4-hydroxyphenyl)-1-ethyl-3H-pyridin-3-id-6-one;yttrium |
| SMILES | CCn1c(-c2c(F)cc(O)cc2F)[c-]cc(Cl)c1=O.[Y] |
| InChI | InChI=1S/C13H9ClF2NO2.Y/c1-2-17-11(4-3-8(14)13(17)19)12-9(15)5-7(18)6-10(12)16;/h3,5-6,18H,2H2,1H3;/q-1; |
| InChIKey | IFVMQBQZKJSDRV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.58 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-2-(2,6-difluoro-4-hydroxyphenyl)-1-ethyl-3H-pyridin-3-id-6-one;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-(2,6-difluoro-4-hydroxyphenyl)-1-ethyl-3H-pyridin-3-id-6-one;yttrium?
The IUPAC name of 5-chloro-2-(2,6-difluoro-4-hydroxyphenyl)-1-ethyl-3H-pyridin-3-id-6-one;yttrium (CID 161120361) is 5-chloro-2-(2,6-difluoro-4-hydroxyphenyl)-1-ethyl-3H-pyridin-3-id-6-one;yttrium.
What is the SMILES notation for 5-chloro-2-(2,6-difluoro-4-hydroxyphenyl)-1-ethyl-3H-pyridin-3-id-6-one;yttrium?
The canonical SMILES for 5-chloro-2-(2,6-difluoro-4-hydroxyphenyl)-1-ethyl-3H-pyridin-3-id-6-one;yttrium is CCn1c(-c2c(F)cc(O)cc2F)[c-]cc(Cl)c1=O.[Y].
What is the InChIKey of 5-chloro-2-(2,6-difluoro-4-hydroxyphenyl)-1-ethyl-3H-pyridin-3-id-6-one;yttrium?
The InChIKey is IFVMQBQZKJSDRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9ClF2NO2.Y/c1-2-17-11(4-3-8(14)13(17)19)12-9(15)5-7(18)6-10(12)16;/h3,5-6,18H,2H2,1H3;/q-1;.
What are the key properties of 5-chloro-2-(2,6-difluoro-4-hydroxyphenyl)-1-ethyl-3H-pyridin-3-id-6-one;yttrium?
5-chloro-2-(2,6-difluoro-4-hydroxyphenyl)-1-ethyl-3H-pyridin-3-id-6-one;yttrium has a molecular weight of 373.58 g/mol, XLogP of 2.97, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-(2,6-difluoro-4-hydroxyphenyl)-1-ethyl-3H-pyridin-3-id-6-one;yttrium is sourced from PubChem (CID 161120361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).