C18H8F6 — CID 161120611
1,2,4-trifluoro-3-[2-(2,3,5-trifluorophenyl)phenyl]benzene (PubChem CID 161120611) has the molecular formula C18H8F6 and a molecular weight of 338.25 g/mol. Its IUPAC name is 1,2,4-trifluoro-3-[2-(2,3,5-trifluorophenyl)phenyl]benzene.
| Compound Name | 1,2,4-trifluoro-3-[2-(2,3,5-trifluorophenyl)phenyl]benzene |
|---|---|
| PubChem CID | 161120611 |
| Molecular Formula | C18H8F6 |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 1,2,4-trifluoro-3-[2-(2,3,5-trifluorophenyl)phenyl]benzene |
| SMILES | Fc1cc(F)c(F)c(-c2ccccc2-c2c(F)ccc(F)c2F)c1 |
| InChI | InChI=1S/C18H8F6/c19-9-7-12(17(23)15(22)8-9)10-3-1-2-4-11(10)16-13(20)5-6-14(21)18(16)24/h1-8H |
| InChIKey | UKXBEJHIFCUWPD-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|