C29H29NO4 — CID 161120647
6-[4-[(R)-(3-methoxyphenyl)-phenylmethyl]piperidine-1-carbonyl]-4H-chromen-3-one (PubChem CID 161120647) has the molecular formula C29H29NO4 and a molecular weight of 455.55 g/mol. Its IUPAC name is 6-[4-[(R)-(3-methoxyphenyl)-phenylmethyl]piperidine-1-carbonyl]-4H-chromen-3-one.
| Compound Name | 6-[4-[(R)-(3-methoxyphenyl)-phenylmethyl]piperidine-1-carbonyl]-4H-chromen-3-one |
|---|---|
| PubChem CID | 161120647 |
| Molecular Formula | C29H29NO4 |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 6-[4-[(R)-(3-methoxyphenyl)-phenylmethyl]piperidine-1-carbonyl]-4H-chromen-3-one |
| SMILES | COc1cccc([C@@H](c2ccccc2)C2CCN(C(=O)c3ccc4c(c3)CC(=O)CO4)CC2)c1 |
| InChI | InChI=1S/C29H29NO4/c1-33-26-9-5-8-22(18-26)28(20-6-3-2-4-7-20)21-12-14-30(15-13-21)29(32)23-10-11-27-24(16-23)17-25(31)19-34-27/h2-11,16,18,21,28H,12-15,17,19H2,1H3/t28-/m0/s1 |
| InChIKey | UKXFCRRIEQDOEX-NDEPHWFRSA-N |
| XLogP | 4.88 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |