C22H22F6N2O2 — CID 161121216
2-phenyl-N-[[(2S)-1-[4-(trifluoromethyl)phenyl]pyrrolidin-2-yl]methyl]acetamide;2,2,2-trifluoroacetaldehyde (PubChem CID 161121216) has the molecular formula C22H22F6N2O2 and a molecular weight of 460.42 g/mol. Its IUPAC name is 2-phenyl-N-[[(2S)-1-[4-(trifluoromethyl)phenyl]pyrrolidin-2-yl]methyl]acetamide;2,2,2-trifluoroacetaldehyde.
| Compound Name | 2-phenyl-N-[[(2S)-1-[4-(trifluoromethyl)phenyl]pyrrolidin-2-yl]methyl]acetamide;2,2,2-trifluoroacetaldehyde |
|---|---|
| PubChem CID | 161121216 |
| Molecular Formula | C22H22F6N2O2 |
| Molecular Weight | 460.42 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 2-phenyl-N-[[(2S)-1-[4-(trifluoromethyl)phenyl]pyrrolidin-2-yl]methyl]acetamide;2,2,2-trifluoroacetaldehyde |
| SMILES | O=C(Cc1ccccc1)NC[C@@H]1CCCN1c1ccc(C(F)(F)F)cc1.O=CC(F)(F)F |
| InChI | InChI=1S/C20H21F3N2O.C2HF3O/c21-20(22,23)16-8-10-17(11-9-16)25-12-4-7-18(25)14-24-19(26)13-15-5-2-1-3-6-15;3-2(4,5)1-6/h1-3,5-6,8-11,18H,4,7,12-14H2,(H,24,26);1H/t18-;/m0./s1 |
| InChIKey | UKYZKRKAIZMDEO-FERBBOLQSA-N |
| XLogP | 4.78 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.42 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|