C18H21Cl2NO3 — CID 161121270
benzoic acid;(5R)-3,7-dichloro-5-methyl-1,2,4,5-tetrahydro-3-benzazepine;hydrate (PubChem CID 161121270) has the molecular formula C18H21Cl2NO3 and a molecular weight of 370.28 g/mol. Its IUPAC name is benzoic acid;(5R)-3,7-dichloro-5-methyl-1,2,4,5-tetrahydro-3-benzazepine;hydrate.
| Compound Name | benzoic acid;(5R)-3,7-dichloro-5-methyl-1,2,4,5-tetrahydro-3-benzazepine;hydrate |
|---|---|
| PubChem CID | 161121270 |
| Molecular Formula | C18H21Cl2NO3 |
| Molecular Weight | 370.28 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | benzoic acid;(5R)-3,7-dichloro-5-methyl-1,2,4,5-tetrahydro-3-benzazepine;hydrate |
| SMILES | C[C@H]1CN(Cl)CCc2ccc(Cl)cc21.O.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C11H13Cl2N.C7H6O2.H2O/c1-8-7-14(13)5-4-9-2-3-10(12)6-11(8)9;8-7(9)6-4-2-1-3-5-6;/h2-3,6,8H,4-5,7H2,1H3;1-5H,(H,8,9);1H2/t8-;;/m0../s1 |
| InChIKey | UKZDYXOTTHKTAX-JZGIKJSDSA-N |
| XLogP | 4.02 |
| TPSA | 72.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.28 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|