About (4-acetamidophenyl) 2-chloroacetate;(4-acetamidophenyl) 2-pyridin-1-ium-1-ylacetate;chloride
(4-acetamidophenyl) 2-chloroacetate;(4-acetamidophenyl) 2-pyridin-1-ium-1-ylacetate;chloride (PubChem CID 161124786) has the molecular formula C25H25Cl2N3O6
and a molecular weight of 534.40 g/mol. Its IUPAC name is (4-acetamidophenyl) 2-chloroacetate;(4-acetamidophenyl) 2-pyridin-1-ium-1-ylacetate;chloride.
Molecular Properties
| Compound Name | (4-acetamidophenyl) 2-chloroacetate;(4-acetamidophenyl) 2-pyridin-1-ium-1-ylacetate;chloride |
| PubChem CID | 161124786 |
| Molecular Formula | C25H25Cl2N3O6 |
| Molecular Weight | 534.40 g/mol |
| Exact Mass | 533.11 |
| IUPAC Name | (4-acetamidophenyl) 2-chloroacetate;(4-acetamidophenyl) 2-pyridin-1-ium-1-ylacetate;chloride |
| SMILES | CC(=O)Nc1ccc(OC(=O)CCl)cc1.CC(=O)Nc1ccc(OC(=O)C[n+]2ccccc2)cc1.[Cl-] |
| InChI | InChI=1S/C15H14N2O3.C10H10ClNO3.ClH/c1-12(18)16-13-5-7-14(8-6-13)20-15(19)11-17-9-3-2-4-10-17;1-7(13)12-8-2-4-9(5-3-8)15-10(14)6-11;/h2-10H,11H2,1H3;2-5H,6H2,1H3,(H,12,13);1H |
| InChIKey | NSZVTIGTSOHIHJ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 534.40 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (4-acetamidophenyl) 2-chloroacetate;(4-acetamidophenyl) 2-pyridin-1-ium-1-ylacetate;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-acetamidophenyl) 2-chloroacetate;(4-acetamidophenyl) 2-pyridin-1-ium-1-ylacetate;chloride?
The IUPAC name of (4-acetamidophenyl) 2-chloroacetate;(4-acetamidophenyl) 2-pyridin-1-ium-1-ylacetate;chloride (CID 161124786) is (4-acetamidophenyl) 2-chloroacetate;(4-acetamidophenyl) 2-pyridin-1-ium-1-ylacetate;chloride.
What is the SMILES notation for (4-acetamidophenyl) 2-chloroacetate;(4-acetamidophenyl) 2-pyridin-1-ium-1-ylacetate;chloride?
The canonical SMILES for (4-acetamidophenyl) 2-chloroacetate;(4-acetamidophenyl) 2-pyridin-1-ium-1-ylacetate;chloride is CC(=O)Nc1ccc(OC(=O)CCl)cc1.CC(=O)Nc1ccc(OC(=O)C[n+]2ccccc2)cc1.[Cl-].
What is the InChIKey of (4-acetamidophenyl) 2-chloroacetate;(4-acetamidophenyl) 2-pyridin-1-ium-1-ylacetate;chloride?
The InChIKey is NSZVTIGTSOHIHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O3.C10H10ClNO3.ClH/c1-12(18)16-13-5-7-14(8-6-13)20-15(19)11-17-9-3-2-4-10-17;1-7(13)12-8-2-4-9(5-3-8)15-10(14)6-11;/h2-10H,11H2,1H3;2-5H,6H2,1H3,(H,12,13);1H.
What are the key properties of (4-acetamidophenyl) 2-chloroacetate;(4-acetamidophenyl) 2-pyridin-1-ium-1-ylacetate;chloride?
(4-acetamidophenyl) 2-chloroacetate;(4-acetamidophenyl) 2-pyridin-1-ium-1-ylacetate;chloride has a molecular weight of 534.40 g/mol, XLogP of 0.33, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-acetamidophenyl) 2-chloroacetate;(4-acetamidophenyl) 2-pyridin-1-ium-1-ylacetate;chloride is sourced from PubChem (CID 161124786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).